move webex specific things in their own directory

author: Florian Dold <florian.dold@gmail.com> 2017-05-28 23:15:41 +0200
committer: Florian Dold <florian.dold@gmail.com> 2017-05-28 23:15:41 +0200
commit: b6e774585d32017e5f1ceeeb2b2e2a5e350354d3 (patch)
tree: 080cb5afe3b48c0428abd2d7de1ff7fe34d9b9b1 /src/webex
parent: 38a74188d759444d7e1abac856f78ae710e2a4c5 (diff)
32 files changed, 6532 insertions, 0 deletions
diff --git a/src/webex/background.html b/src/webex/background.html
new file mode 100644
index 000000000..0535dd5f3
--- /dev/null
+++ b/src/webex/background.html
@@ -0,0 +1,11 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+  <meta charset="UTF-8">
+  <script src="../../dist/background-bundle.js"></script>
+  <title>(wallet bg page)</title>
+</head>
+<body>
+  <img id="taler-logo" src="/img/icon.png">
+</body>
+</html>
diff --git a/src/webex/background.ts b/src/webex/background.ts
new file mode 100644
index 000000000..3c63f323e
--- /dev/null
+++ b/src/webex/background.ts
@@ -0,0 +1,30 @@
+/*
+ This file is part of TALER
+ (C) 2016 GNUnet e.V.
+
+ TALER is free software; you can redistribute it and/or modify it under the
+ terms of the GNU General Public License as published by the Free Software
+ Foundation; either version 3, or (at your option) any later version.
+
+ TALER is distributed in the hope that it will be useful, but WITHOUT ANY
+ WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR
+ A PARTICULAR PURPOSE.  See the GNU General Public License for more details.
+
+ You should have received a copy of the GNU General Public License along with
+ TALER; see the file COPYING.  If not, see <http://www.gnu.org/licenses/>
+ */
+
+/**
+ * Entry point for the background page.
+ *
+ * @author Florian Dold
+ */
+
+/**
+ * Imports.
+ */
+import {wxMain} from "./wxBackend";
+
+window.addEventListener("load", () => {
+  wxMain();
+});
diff --git a/src/webex/chromeBadge.ts b/src/webex/chromeBadge.ts
new file mode 100644
index 000000000..13add9b3f
--- /dev/null
+++ b/src/webex/chromeBadge.ts
@@ -0,0 +1,225 @@
+/*
+ This file is part of TALER
+ (C) 2016 INRIA
+
+ TALER is free software; you can redistribute it and/or modify it under the
+ terms of the GNU General Public License as published by the Free Software
+ Foundation; either version 3, or (at your option) any later version.
+
+ TALER is distributed in the hope that it will be useful, but WITHOUT ANY
+ WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR
+ A PARTICULAR PURPOSE.  See the GNU General Public License for more details.
+
+ You should have received a copy of the GNU General Public License along with
+ TALER; see the file COPYING.  If not, see <http://www.gnu.org/licenses/>
+ */
+
+import {
+  Badge,
+} from "../wallet";
+
+
+/**
+ * Polyfill for requestAnimationFrame, which
+ * doesn't work from a background page.
+ */
+function rAF(cb: (ts: number) => void) {
+  window.setTimeout(() => {
+    cb(performance.now());
+  }, 100 /* 100 ms delay between frames */);
+}
+
+
+/**
+ * Badge for Chrome that renders a Taler logo with a rotating ring if some
+ * background activity is happening.
+ */
+export class ChromeBadge implements Badge {
+  private canvas: HTMLCanvasElement;
+  private ctx: CanvasRenderingContext2D;
+  /**
+   * True if animation running.  The animation
+   * might still be running even if we're not busy anymore,
+   * just to transition to the "normal" state in a animated way.
+   */
+  private animationRunning: boolean = false;
+
+  /**
+   * Is the wallet still busy? Note that we do not stop the
+   * animation immediately when the wallet goes idle, but
+   * instead slowly close the gap.
+   */
+  private isBusy: boolean = false;
+
+  /**
+   * Current rotation angle, ranges from 0 to rotationAngleMax.
+   */
+  private rotationAngle: number = 0;
+
+  /**
+   * While animating, how wide is the current gap in the circle?
+   * Ranges from 0 to openMax.
+   */
+  private gapWidth: number = 0;
+
+  /**
+   * Maximum value for our rotationAngle, corresponds to 2 Pi.
+   */
+  static rotationAngleMax = 1000;
+
+  /**
+   * How fast do we rotate?  Given in rotation angle (relative to rotationAngleMax) per millisecond.
+   */
+  static rotationSpeed = 0.5;
+
+  /**
+   * How fast to we open?  Given in rotation angle (relative to rotationAngleMax) per millisecond.
+   */
+  static openSpeed = 0.15;
+
+  /**
+   * How fast to we close?  Given as a multiplication factor per frame update.
+   */
+  static closeSpeed = 0.7;
+
+  /**
+   * How far do we open? Given relative to rotationAngleMax.
+   */
+  static openMax = 100;
+
+  constructor(window?: Window) {
+    // Allow injecting another window for testing
+    const bg = window || chrome.extension.getBackgroundPage();
+    if (!bg) {
+      throw Error("no window available");
+    }
+    this.canvas = bg.document.createElement("canvas");
+    // Note: changing the width here means changing the font
+    // size in draw() as well!
+    this.canvas.width = 32;
+    this.canvas.height = 32;
+    this.ctx = this.canvas.getContext("2d")!;
+    this.draw();
+  }
+
+  /**
+   * Draw the badge based on the current state.
+   */
+  private draw() {
+    this.ctx.setTransform(1, 0, 0, 1, 0, 0);
+    this.ctx.clearRect(0, 0, this.canvas.width, this.canvas.height);
+
+    this.ctx.translate(this.canvas.width / 2, this.canvas.height / 2);
+
+    this.ctx.beginPath();
+    this.ctx.arc(0, 0, this.canvas.width / 2 - 2, 0, 2 * Math.PI);
+    this.ctx.fillStyle = "white";
+    this.ctx.fill();
+
+    // move into the center, off by 2 for aligning the "T" with the bottom
+    // of the circle.
+    this.ctx.translate(0, 2);
+
+    // pick sans-serif font; note: 14px is based on the 32px width above!
+    this.ctx.font = "bold 24px sans-serif";
+    // draw the "T" perfectly centered (x and y) to the current position
+    this.ctx.textAlign = "center";
+    this.ctx.textBaseline = "middle";
+    this.ctx.fillStyle = "black";
+    this.ctx.fillText("T", 0, 0);
+    // now move really into the center
+    this.ctx.translate(0, -2);
+    // start drawing the (possibly open) circle
+    this.ctx.beginPath();
+    this.ctx.lineWidth = 2.5;
+    if (this.animationRunning) {
+      /* Draw circle around the "T" with an opening of this.gapWidth */
+      const aMax = ChromeBadge.rotationAngleMax;
+      const startAngle = this.rotationAngle / aMax * Math.PI * 2;
+      const stopAngle = ((this.rotationAngle + aMax - this.gapWidth) / aMax) * Math.PI * 2;
+      this.ctx.arc(0, 0, this.canvas.width / 2 - 2, /* radius */ startAngle, stopAngle, false);
+    } else {
+      /* Draw full circle */
+      this.ctx.arc(0, 0,
+                   this.canvas.width / 2 - 2, /* radius */
+                   0,
+                   Math.PI * 2,
+                   false);
+    }
+    this.ctx.stroke();
+    // go back to the origin
+    this.ctx.translate(-this.canvas.width / 2, -this.canvas.height / 2);
+
+    // Allow running outside the extension for testing
+    // tslint:disable-next-line:no-string-literal
+    if (window["chrome"] && window.chrome["browserAction"]) {
+      try {
+        const imageData = this.ctx.getImageData(0,
+                                                0,
+                                                this.canvas.width,
+                                                this.canvas.height);
+        chrome.browserAction.setIcon({imageData});
+      } catch (e) {
+        // Might fail if browser has over-eager canvas fingerprinting countermeasures.
+        // There's nothing we can do then ...
+      }
+    }
+  }
+
+  private animate() {
+    if (this.animationRunning) {
+      return;
+    }
+    this.animationRunning = true;
+    let start: number|undefined;
+    const step = (timestamp: number) => {
+      if (!this.animationRunning) {
+        return;
+      }
+      if (!start) {
+        start = timestamp;
+      }
+      if (!this.isBusy && 0 === this.gapWidth) {
+        // stop if we're close enough to origin
+        this.rotationAngle = 0;
+      } else {
+        this.rotationAngle = (this.rotationAngle + (timestamp - start) *
+                              ChromeBadge.rotationSpeed) % ChromeBadge.rotationAngleMax;
+      }
+      if (this.isBusy) {
+        if (this.gapWidth < ChromeBadge.openMax) {
+          this.gapWidth += ChromeBadge.openSpeed * (timestamp - start);
+        }
+        if (this.gapWidth > ChromeBadge.openMax) {
+          this.gapWidth = ChromeBadge.openMax;
+        }
+      } else {
+        if (this.gapWidth > 0) {
+          this.gapWidth--;
+          this.gapWidth *= ChromeBadge.closeSpeed;
+        }
+      }
+
+      if (this.isBusy || this.gapWidth > 0) {
+        start = timestamp;
+        rAF(step);
+      } else {
+        this.animationRunning = false;
+      }
+      this.draw();
+    };
+    rAF(step);
+  }
+
+  startBusy() {
+    if (this.isBusy) {
+      return;
+    }
+    this.isBusy = true;
+    this.animate();
+  }
+
+  stopBusy() {
+    this.isBusy = false;
+  }
+}
diff --git a/src/webex/components.ts b/src/webex/components.ts
new file mode 100644
index 000000000..1f5d18731
--- /dev/null
+++ b/src/webex/components.ts
@@ -0,0 +1,63 @@
+/*
+ This file is part of TALER
+ (C) 2016 Inria
+
+ TALER is free software; you can redistribute it and/or modify it under the
+ terms of the GNU General Public License as published by the Free Software
+ Foundation; either version 3, or (at your option) any later version.
+
+ TALER is distributed in the hope that it will be useful, but WITHOUT ANY
+ WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR
+ A PARTICULAR PURPOSE.  See the GNU General Public License for more details.
+
+ You should have received a copy of the GNU General Public License along with
+ TALER; see the file COPYING.  If not, see <http://www.gnu.org/licenses/>
+ */
+
+
+/**
+ * General helper React components.
+ */
+
+
+/**
+ * Imports.
+ */
+import * as React from "react";
+
+/**
+ * Wrapper around state that will cause updates to the
+ * containing component.
+ */
+export interface StateHolder<T> {
+  (): T;
+  (newState: T): void;
+}
+
+/**
+ * Component that doesn't hold its state in one object,
+ * but has multiple state holders.
+ */
+export abstract class ImplicitStateComponent<PropType> extends React.Component<PropType, any> {
+  private _implicit = {needsUpdate: false, didMount: false};
+  componentDidMount() {
+    this._implicit.didMount = true;
+    if (this._implicit.needsUpdate) {
+      this.setState({} as any);
+    }
+  }
+  makeState<StateType>(initial: StateType): StateHolder<StateType> {
+    let state: StateType = initial;
+    return (s?: StateType): StateType => {
+      if (s !== undefined) {
+        state = s;
+        if (this._implicit.didMount) {
+          this.setState({} as any);
+        } else {
+          this._implicit.needsUpdate = true;
+        }
+      }
+      return state;
+    };
+  }
+}
diff --git a/src/webex/notify.ts b/src/webex/notify.ts
new file mode 100644
index 000000000..733367a59
--- /dev/null
+++ b/src/webex/notify.ts
@@ -0,0 +1,571 @@
+/*
+ This file is part of TALER
+ (C) 2015 GNUnet e.V.
+
+ TALER is free software; you can redistribute it and/or modify it under the
+ terms of the GNU General Public License as published by the Free Software
+ Foundation; either version 3, or (at your option) any later version.
+
+ TALER is distributed in the hope that it will be useful, but WITHOUT ANY
+ WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR
+ A PARTICULAR PURPOSE.  See the GNU General Public License for more details.
+
+ You should have received a copy of the GNU General Public License along with
+ TALER; see the file COPYING.  If not, see <http://www.gnu.org/licenses/>
+ */
+
+// tslint:disable:no-unused-expression
+
+/**
+ * Module that is injected into (all!) pages to allow them
+ * to interact with the GNU Taler wallet via DOM Events.
+ */
+
+
+/**
+ * Imports.
+ */
+import URI = require("urijs");
+
+declare var cloneInto: any;
+
+const PROTOCOL_VERSION = 1;
+
+let logVerbose: boolean = false;
+try {
+  logVerbose = !!localStorage.getItem("taler-log-verbose");
+} catch (e) {
+  // can't read from local storage
+}
+
+if (document.documentElement.getAttribute("data-taler-nojs")) {
+  document.dispatchEvent(new Event("taler-probe-result"));
+}
+
+
+function subst(url: string, H_contract: string) {
+  url = url.replace("${H_contract}", H_contract);
+  url = url.replace("${$}", "$");
+  return url;
+}
+
+interface Handler {
+  type: string;
+  listener: (e: CustomEvent) => void|Promise<void>;
+}
+const handlers: Handler[] = [];
+
+function hashContract(contract: string): Promise<string> {
+  const walletHashContractMsg = {
+    detail: {contract},
+    type: "hash-contract",
+  };
+  return new Promise<string>((resolve, reject) => {
+    chrome.runtime.sendMessage(walletHashContractMsg, (resp: any) => {
+      if (!resp.hash) {
+        console.log("error", resp);
+        reject(Error("hashing failed"));
+      }
+      resolve(resp.hash);
+    });
+  });
+}
+
+function queryPayment(url: string): Promise<any> {
+  const walletMsg = {
+    detail: { url },
+    type: "query-payment",
+  };
+  return new Promise((resolve, reject) => {
+    chrome.runtime.sendMessage(walletMsg, (resp: any) => {
+      resolve(resp);
+    });
+  });
+}
+
+function putHistory(historyEntry: any): Promise<void> {
+  const walletMsg = {
+    detail: {
+      historyEntry,
+    },
+    type: "put-history-entry",
+  };
+  return new Promise<void>((resolve, reject) => {
+    chrome.runtime.sendMessage(walletMsg, (resp: any) => {
+      resolve();
+    });
+  });
+}
+
+function saveOffer(offer: any): Promise<number> {
+  const walletMsg = {
+    detail: {
+      offer: {
+        H_contract: offer.hash,
+        contract: offer.data,
+        merchant_sig: offer.sig,
+        offer_time: new Date().getTime() / 1000,
+      },
+    type: "save-offer",
+    },
+  };
+  return new Promise<number>((resolve, reject) => {
+    chrome.runtime.sendMessage(walletMsg, (resp: any) => {
+      if (resp && resp.error) {
+        reject(resp);
+      } else {
+        resolve(resp);
+      }
+    });
+  });
+}
+
+
+let sheet: CSSStyleSheet|null;
+
+function initStyle() {
+  logVerbose && console.log("taking over styles");
+  const name = "taler-presence-stylesheet";
+  const content = "/* Taler stylesheet controlled by JS */";
+  let style = document.getElementById(name) as HTMLStyleElement|null;
+  if (!style) {
+    style = document.createElement("style");
+    // Needed by WebKit
+    style.appendChild(document.createTextNode(content));
+    style.id = name;
+    document.head.appendChild(style);
+    sheet = style.sheet as CSSStyleSheet;
+  } else {
+    // We've taken over the stylesheet now,
+    // make it clear by clearing all the rules in it
+    // and making it obvious in the DOM.
+    if (style.tagName.toLowerCase() === "style") {
+      style.innerText = content;
+    }
+    if (!style.sheet) {
+      throw Error("taler-presence-stylesheet should be a style sheet (<link> or <style>)");
+    }
+    sheet = style.sheet as CSSStyleSheet;
+    while (sheet.cssRules.length > 0) {
+      sheet.deleteRule(0);
+    }
+  }
+}
+
+
+function setStyles(installed: boolean) {
+  if (!sheet || !sheet.cssRules) {
+    return;
+  }
+  while (sheet.cssRules.length > 0) {
+    sheet.deleteRule(0);
+  }
+  if (installed) {
+    sheet.insertRule(".taler-installed-hide { display: none; }", 0);
+    sheet.insertRule(".taler-probed-hide { display: none; }", 0);
+  } else {
+    sheet.insertRule(".taler-installed-show { display: none; }", 0);
+  }
+}
+
+
+function handlePaymentResponse(walletResp: any) {
+  /**
+   * Handle a failed payment.
+   *
+   * Try to notify the wallet first, before we show a potentially
+   * synchronous error message (such as an alert) or leave the page.
+   */
+  function handleFailedPayment(r: XMLHttpRequest) {
+    let timeoutHandle: number|null = null;
+    function err() {
+      // FIXME: proper error reporting!
+      console.log("pay-failed", {status: r.status, response: r.responseText});
+    }
+    function onTimeout() {
+      timeoutHandle = null;
+      err();
+    }
+    talerPaymentFailed(walletResp.H_contract).then(() => {
+      if (timeoutHandle !== null) {
+        clearTimeout(timeoutHandle);
+        timeoutHandle = null;
+      }
+      err();
+    });
+    timeoutHandle = window.setTimeout(onTimeout, 200);
+  }
+
+
+  logVerbose && console.log("handling taler-notify-payment: ", walletResp);
+  // Payment timeout in ms.
+  let timeout_ms = 1000;
+  // Current request.
+  let r: XMLHttpRequest|null;
+  let timeoutHandle: number|null = null;
+  function sendPay() {
+    r = new XMLHttpRequest();
+    r.open("post", walletResp.contract.pay_url);
+    r.setRequestHeader("Content-Type", "application/json;charset=UTF-8");
+    r.send(JSON.stringify(walletResp.payReq));
+    r.onload = () => {
+      if (!r) {
+        return;
+      }
+      switch (r.status) {
+        case 200:
+          const merchantResp = JSON.parse(r.responseText);
+          logVerbose && console.log("got success from pay_url");
+          talerPaymentSucceeded({H_contract: walletResp.H_contract, merchantSig: merchantResp.sig}).then(() => {
+            const nextUrl = walletResp.contract.fulfillment_url;
+            logVerbose && console.log("taler-payment-succeeded done, going to", nextUrl);
+            window.location.href = nextUrl;
+            window.location.reload(true);
+          });
+          break;
+        default:
+          handleFailedPayment(r);
+          break;
+      }
+      r = null;
+      if (timeoutHandle !== null) {
+        clearTimeout(timeoutHandle!);
+        timeoutHandle = null;
+      }
+    };
+    function retry() {
+      if (r) {
+        r.abort();
+        r = null;
+      }
+      timeout_ms = Math.min(timeout_ms * 2, 10 * 1000);
+      logVerbose && console.log("sendPay timed out, retrying in ", timeout_ms, "ms");
+      sendPay();
+    }
+    timeoutHandle = window.setTimeout(retry, timeout_ms);
+  }
+  sendPay();
+}
+
+
+function init() {
+  chrome.runtime.sendMessage({type: "get-tab-cookie"}, (resp) => {
+    if (chrome.runtime.lastError) {
+      logVerbose && console.log("extension not yet ready");
+      window.setTimeout(init, 200);
+      return;
+    }
+    if (document.documentElement.getAttribute("data-taler-nojs")) {
+      const onload = () => {
+        initStyle();
+        setStyles(true);
+      };
+      if (document.readyState === "complete") {
+        onload();
+      } else {
+        document.addEventListener("DOMContentLoaded", onload);
+      }
+    }
+    registerHandlers();
+    // Hack to know when the extension is unloaded
+    const port = chrome.runtime.connect();
+
+    port.onDisconnect.addListener(() => {
+      logVerbose && console.log("chrome runtime disconnected, removing handlers");
+      if (document.documentElement.getAttribute("data-taler-nojs")) {
+        setStyles(false);
+      }
+      for (const handler of handlers) {
+        document.removeEventListener(handler.type, handler.listener);
+      }
+    });
+
+    if (resp && resp.type === "pay") {
+      logVerbose && console.log("doing taler.pay with", resp.payDetail);
+      talerPay(resp.payDetail).then(handlePaymentResponse);
+      document.documentElement.style.visibility = "hidden";
+    }
+  });
+}
+
+type HandlerFn = (detail: any, sendResponse: (msg: any) => void) => void;
+
+function generateNonce(): Promise<string> {
+  const walletMsg = {
+    type: "generate-nonce",
+  };
+  return new Promise<string>((resolve, reject) => {
+    chrome.runtime.sendMessage(walletMsg, (resp: any) => {
+      resolve(resp);
+    });
+  });
+}
+
+function downloadContract(url: string, nonce: string): Promise<any> {
+  const parsed_url = new URI(url);
+  url = parsed_url.setQuery({nonce}).href();
+  // FIXME: include and check nonce!
+  return new Promise((resolve, reject) => {
+    const contract_request = new XMLHttpRequest();
+    console.log("downloading contract from '" + url + "'");
+    contract_request.open("GET", url, true);
+    contract_request.onload = (e) => {
+      if (contract_request.readyState === 4) {
+        if (contract_request.status === 200) {
+          console.log("response text:",
+                      contract_request.responseText);
+          const contract_wrapper = JSON.parse(contract_request.responseText);
+          if (!contract_wrapper) {
+            console.error("response text was invalid json");
+            const detail = {
+              body: contract_request.responseText,
+              hint: "invalid json",
+              status: contract_request.status,
+            };
+            reject(detail);
+            return;
+          }
+          resolve(contract_wrapper);
+        } else {
+          const detail = {
+            body: contract_request.responseText,
+            hint: "contract download failed",
+            status: contract_request.status,
+          };
+          reject(detail);
+          return;
+        }
+      }
+    };
+    contract_request.onerror = (e) => {
+      const detail = {
+        body: contract_request.responseText,
+        hint: "contract download failed",
+        status: contract_request.status,
+      };
+      reject(detail);
+      return;
+    };
+    contract_request.send();
+  });
+}
+
+async function processProposal(proposal: any) {
+  if (!proposal.data) {
+    console.error("field proposal.data field missing");
+    return;
+  }
+
+  if (!proposal.hash) {
+    console.error("proposal.hash field missing");
+    return;
+  }
+
+  const contractHash = await hashContract(proposal.data);
+
+  if (contractHash !== proposal.hash) {
+    console.error("merchant-supplied contract hash is wrong");
+    return;
+  }
+
+  let merchantName = "(unknown)";
+  try {
+    merchantName = proposal.data.merchant.name;
+  } catch (e) {
+    // bad contract / name not included
+  }
+
+  const historyEntry = {
+    detail: {
+      contractHash,
+      merchantName,
+    },
+    subjectId: `contract-${contractHash}`,
+    timestamp: (new Date()).getTime(),
+    type: "offer-contract",
+  };
+  await putHistory(historyEntry);
+  const offerId = await saveOffer(proposal);
+
+  const uri = new URI(chrome.extension.getURL(
+    "/src/pages/confirm-contract.html"));
+  const params = {
+    offerId: offerId.toString(),
+  };
+  const target = uri.query(params).href();
+  document.location.replace(target);
+}
+
+function talerPay(msg: any): Promise<any> {
+  return new Promise(async(resolve, reject) => {
+    // current URL without fragment
+    const url = new URI(document.location.href).fragment("").href();
+    const res = await queryPayment(url);
+    logVerbose && console.log("taler-pay: got response", res);
+    if (res && res.payReq) {
+      resolve(res);
+      return;
+    }
+    if (msg.contract_url) {
+      const nonce = await generateNonce();
+      const proposal = await downloadContract(msg.contract_url, nonce);
+      if (proposal.data.nonce !== nonce) {
+        console.error("stale contract");
+        return;
+      }
+      await processProposal(proposal);
+      return;
+    }
+
+    if (msg.offer_url) {
+      document.location.href = msg.offer_url;
+      return;
+    }
+
+    console.log("can't proceed with payment, no way to get contract specified");
+  });
+}
+
+function talerPaymentFailed(H_contract: string) {
+  return new Promise(async(resolve, reject) => {
+    const walletMsg = {
+      detail: {
+        contractHash: H_contract,
+      },
+      type: "payment-failed",
+    };
+    chrome.runtime.sendMessage(walletMsg, (resp) => {
+      resolve();
+    });
+  });
+}
+
+function talerPaymentSucceeded(msg: any) {
+  return new Promise((resolve, reject) => {
+    if (!msg.H_contract) {
+      console.error("H_contract missing in taler-payment-succeeded");
+      return;
+    }
+    if (!msg.merchantSig) {
+      console.error("merchantSig missing in taler-payment-succeeded");
+      return;
+    }
+    logVerbose && console.log("got taler-payment-succeeded");
+    const walletMsg = {
+      detail: {
+        contractHash: msg.H_contract,
+        merchantSig: msg.merchantSig,
+      },
+      type: "payment-succeeded",
+    };
+    chrome.runtime.sendMessage(walletMsg, (resp) => {
+      resolve();
+    });
+  });
+}
+
+
+function registerHandlers() {
+  /**
+   * Add a handler for a DOM event, which automatically
+   * handles adding sequence numbers to responses.
+   */
+  function addHandler(type: string, handler: HandlerFn) {
+    const handlerWrap = (e: CustomEvent) => {
+      if (e.type !== type) {
+        throw Error(`invariant violated`);
+      }
+      let callId: number|undefined;
+      if (e.detail && e.detail.callId !== undefined) {
+        callId = e.detail.callId;
+      }
+      const responder = (msg?: any) => {
+        const fullMsg = Object.assign({}, msg, {callId});
+        let opts = { detail: fullMsg };
+        if ("function" === typeof cloneInto) {
+          opts = cloneInto(opts, document.defaultView);
+        }
+        const evt = new CustomEvent(type + "-result", opts);
+        document.dispatchEvent(evt);
+      };
+      handler(e.detail, responder);
+    };
+    document.addEventListener(type, handlerWrap);
+    handlers.push({type, listener: handlerWrap});
+  }
+
+
+  addHandler("taler-query-id", (msg: any, sendResponse: any) => {
+    // FIXME: maybe include this info in taoer-probe?
+    sendResponse({id: chrome.runtime.id});
+  });
+
+  addHandler("taler-probe", (msg: any, sendResponse: any) => {
+    sendResponse();
+  });
+
+  addHandler("taler-create-reserve", (msg: any) => {
+    const params = {
+      amount: JSON.stringify(msg.amount),
+      bank_url: document.location.href,
+      callback_url: new URI(msg.callback_url) .absoluteTo(document.location.href),
+      suggested_exchange_url: msg.suggested_exchange_url,
+      wt_types: JSON.stringify(msg.wt_types),
+    };
+    const uri = new URI(chrome.extension.getURL("/src/pages/confirm-create-reserve.html"));
+    const redirectUrl = uri.query(params).href();
+    window.location.href = redirectUrl;
+  });
+
+  addHandler("taler-add-auditor", (msg: any) => {
+    const params = {
+      req: JSON.stringify(msg),
+    };
+    const uri = new URI(chrome.extension.getURL("/src/pages/add-auditor.html"));
+    const redirectUrl = uri.query(params).href();
+    window.location.href = redirectUrl;
+  });
+
+  addHandler("taler-confirm-reserve", (msg: any, sendResponse: any) => {
+    const walletMsg = {
+      detail: {
+        reservePub: msg.reserve_pub,
+      },
+      type: "confirm-reserve",
+    };
+    chrome.runtime.sendMessage(walletMsg, (resp) => {
+      sendResponse();
+    });
+  });
+
+
+  addHandler("taler-confirm-contract", async(msg: any) => {
+    if (!msg.contract_wrapper) {
+      console.error("contract wrapper missing");
+      return;
+    }
+
+    const proposal = msg.contract_wrapper;
+
+    processProposal(proposal);
+  });
+
+  addHandler("taler-pay", async(msg: any, sendResponse: any) => {
+    const resp = await talerPay(msg);
+    sendResponse(resp);
+  });
+
+  addHandler("taler-payment-failed", async(msg: any, sendResponse: any) => {
+    await talerPaymentFailed(msg.H_contract);
+    sendResponse();
+  });
+
+  addHandler("taler-payment-succeeded", async(msg: any, sendResponse: any) => {
+    await talerPaymentSucceeded(msg);
+    sendResponse();
+  });
+}
+
+logVerbose && console.log("loading Taler content script");
+init();
+
diff --git a/src/webex/pages/add-auditor.html b/src/webex/pages/add-auditor.html
new file mode 100644
index 000000000..b7a9d041d
--- /dev/null
+++ b/src/webex/pages/add-auditor.html
@@ -0,0 +1,34 @@
+<!DOCTYPE html>
+<html>
+
+<head>
+  <meta charset="UTF-8">
+
+  <title>Taler Wallet: Add Auditor</title>
+
+  <link rel="stylesheet" type="text/css" href="../style/wallet.css">
+
+  <link rel="icon" href="/img/icon.png">
+
+  <script src="/dist/page-common-bundle.js"></script>
+  <script src="/dist/add-auditor-bundle.js"></script>
+
+  <style>
+    .tree-item {
+            margin: 2em;
+            border-radius: 5px;
+            border: 1px solid gray;
+            padding: 1em;
+    }
+    .button-linky {
+      background: none;
+      color: black;
+      text-decoration: underline;
+      border: none;
+    }
+  </style>
+
+  <body>
+    <div id="container"></div>
+  </body>
+</html>
diff --git a/src/webex/pages/add-auditor.tsx b/src/webex/pages/add-auditor.tsx
new file mode 100644
index 000000000..c1a9f997f
--- /dev/null
+++ b/src/webex/pages/add-auditor.tsx
@@ -0,0 +1,126 @@
+/*
+ This file is part of TALER
+ (C) 2017 Inria
+
+ TALER is free software; you can redistribute it and/or modify it under the
+ terms of the GNU General Public License as published by the Free Software
+ Foundation; either version 3, or (at your option) any later version.
+
+ TALER is distributed in the hope that it will be useful, but WITHOUT ANY
+ WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR
+ A PARTICULAR PURPOSE.  See the GNU General Public License for more details.
+
+ You should have received a copy of the GNU General Public License along with
+ TALER; see the file COPYING.  If not, see <http://www.gnu.org/licenses/>
+ */
+
+/**
+ * View and edit auditors.
+ *
+ * @author Florian Dold
+ */
+
+
+import { getTalerStampDate } from "../../helpers";
+import {
+  ExchangeRecord,
+  DenominationRecord,
+  AuditorRecord,
+  CurrencyRecord,
+  ReserveRecord,
+  CoinRecord,
+  PreCoinRecord,
+  Denomination
+} from "../../types";
+
+import { ImplicitStateComponent, StateHolder } from "../components";
+import {
+  getCurrencies,
+  updateCurrency,
+} from "../wxApi";
+
+import * as React from "react";
+import * as ReactDOM from "react-dom";
+import URI = require("urijs");
+
+interface ConfirmAuditorProps {
+  url: string;
+  currency: string;
+  auditorPub: string;
+  expirationStamp: number;
+}
+
+class ConfirmAuditor extends ImplicitStateComponent<ConfirmAuditorProps> {
+  addDone: StateHolder<boolean> = this.makeState(false);
+  constructor() {
+    super();
+  }
+
+  async add() {
+    let currencies = await getCurrencies();
+    let currency: CurrencyRecord|undefined = undefined;
+
+    for (let c of currencies) {
+      if (c.name == this.props.currency) {
+        currency = c;
+      }
+    }
+
+    if (!currency) {
+      currency = { name: this.props.currency, auditors: [], fractionalDigits: 2, exchanges: [] };
+    }
+
+    let newAuditor = { auditorPub: this.props.auditorPub, baseUrl: this.props.url, expirationStamp: this.props.expirationStamp };
+
+    let auditorFound = false;
+    for (let idx in currency.auditors) {
+      let a = currency.auditors[idx];
+      if (a.baseUrl == this.props.url) {
+        auditorFound = true;
+        // Update auditor if already found by URL.
+        currency.auditors[idx] = newAuditor;
+      }
+    }
+
+    if (!auditorFound) {
+      currency.auditors.push(newAuditor);
+    }
+
+    await updateCurrency(currency);
+
+    this.addDone(true);
+  }
+
+  back() {
+    window.history.back();
+  }
+
+  render(): JSX.Element {
+    return (
+      <div id="main">
+        <p>Do you want to let <strong>{this.props.auditorPub}</strong> audit the currency "{this.props.currency}"?</p>
+        {this.addDone() ? 
+          (<div>Auditor was added! You can also <a href={chrome.extension.getURL("/src/pages/auditors.html")}>view and edit</a> auditors.</div>)
+          : 
+          (<div>
+            <button onClick={() => this.add()} className="pure-button pure-button-primary">Yes</button>
+            <button onClick={() => this.back()} className="pure-button">No</button>
+          </div>)
+        }
+      </div>
+    );
+  }
+}
+
+export function main() {
+  const walletPageUrl = new URI(document.location.href);
+  const query: any = JSON.parse((URI.parseQuery(walletPageUrl.query()) as any)["req"]);
+  const url = query.url;
+  const currency: string = query.currency;
+  const auditorPub: string = query.auditorPub;
+  const expirationStamp = Number.parseInt(query.expirationStamp);
+  const args = { url, currency, auditorPub, expirationStamp };
+  ReactDOM.render(<ConfirmAuditor {...args} />, document.getElementById("container")!);
+}
+
+document.addEventListener("DOMContentLoaded", main);
diff --git a/src/webex/pages/auditors.html b/src/webex/pages/auditors.html
new file mode 100644
index 000000000..cbfc3b4b5
--- /dev/null
+++ b/src/webex/pages/auditors.html
@@ -0,0 +1,36 @@
+<!DOCTYPE html>
+<html>
+
+<head>
+  <meta charset="UTF-8">
+  <title>Taler Wallet: Auditors</title>
+
+  <link rel="stylesheet" type="text/css" href="../style/wallet.css">
+
+  <link rel="icon" href="/img/icon.png">
+
+  <script src="/dist/page-common-bundle.js"></script>
+  <script src="/dist/auditors-bundle.js"></script>
+
+  <style>
+    body {
+      font-size: 100%;
+    }
+    .tree-item {
+            margin: 2em;
+            border-radius: 5px;
+            border: 1px solid gray;
+            padding: 1em;
+    }
+    .button-linky {
+      background: none;
+      color: black;
+      text-decoration: underline;
+      border: none;
+    }
+  </style>
+
+  <body>
+    <div id="container"></div>
+  </body>
+</html>
diff --git a/src/webex/pages/auditors.tsx b/src/webex/pages/auditors.tsx
new file mode 100644
index 000000000..dac3c2be9
--- /dev/null
+++ b/src/webex/pages/auditors.tsx
@@ -0,0 +1,147 @@
+/*
+ This file is part of TALER
+ (C) 2017 Inria
+
+ TALER is free software; you can redistribute it and/or modify it under the
+ terms of the GNU General Public License as published by the Free Software
+ Foundation; either version 3, or (at your option) any later version.
+
+ TALER is distributed in the hope that it will be useful, but WITHOUT ANY
+ WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR
+ A PARTICULAR PURPOSE.  See the GNU General Public License for more details.
+
+ You should have received a copy of the GNU General Public License along with
+ TALER; see the file COPYING.  If not, see <http://www.gnu.org/licenses/>
+ */
+
+/**
+ * View and edit auditors.
+ *
+ * @author Florian Dold
+ */
+
+
+import { getTalerStampDate } from "../../helpers";
+import {
+  ExchangeRecord,
+  ExchangeForCurrencyRecord,
+  DenominationRecord,
+  AuditorRecord,
+  CurrencyRecord,
+  ReserveRecord,
+  CoinRecord,
+  PreCoinRecord,
+  Denomination
+} from "../../types";
+
+import { ImplicitStateComponent, StateHolder } from "../components";
+import {
+  getCurrencies,
+  updateCurrency,
+} from "../wxApi";
+import * as React from "react";
+import * as ReactDOM from "react-dom";
+
+interface CurrencyListState {
+  currencies?: CurrencyRecord[];
+}
+
+class CurrencyList extends React.Component<any, CurrencyListState> {
+  constructor() {
+    super();
+    let port = chrome.runtime.connect();
+    port.onMessage.addListener((msg: any) => {
+      if (msg.notify) {
+        console.log("got notified");
+        this.update();
+      }
+    });
+    this.update();
+    this.state = {} as any;
+  }
+
+  async update() {
+    let currencies = await getCurrencies();
+    console.log("currencies: ", currencies);
+    this.setState({ currencies });
+  }
+
+  async confirmRemoveAuditor(c: CurrencyRecord, a: AuditorRecord) {
+    if (window.confirm(`Do you really want to remove auditor ${a.baseUrl} for currency ${c.name}?`)) {
+      c.auditors = c.auditors.filter((x) => x.auditorPub != a.auditorPub);
+      await updateCurrency(c);
+    }
+  }
+
+  async confirmRemoveExchange(c: CurrencyRecord, e: ExchangeForCurrencyRecord) {
+    if (window.confirm(`Do you really want to remove exchange ${e.baseUrl} for currency ${c.name}?`)) {
+      c.exchanges = c.exchanges.filter((x) => x.baseUrl != e.baseUrl);
+      await updateCurrency(c);
+    }
+  }
+
+  renderAuditors(c: CurrencyRecord): any {
+    if (c.auditors.length == 0) {
+      return <p>No trusted auditors for this currency.</p>
+    }
+    return (
+      <div>
+        <p>Trusted Auditors:</p>
+        <ul>
+        {c.auditors.map(a => (
+          <li>{a.baseUrl} <button className="pure-button button-destructive" onClick={() => this.confirmRemoveAuditor(c, a)}>Remove</button>
+            <ul>
+              <li>valid until {new Date(a.expirationStamp).toString()}</li>
+              <li>public key {a.auditorPub}</li>
+            </ul>
+          </li>
+        ))}
+        </ul>
+      </div>
+    );
+  }
+
+  renderExchanges(c: CurrencyRecord): any {
+    if (c.exchanges.length == 0) {
+      return <p>No trusted exchanges for this currency.</p>
+    }
+    return (
+      <div>
+        <p>Trusted Exchanges:</p>
+        <ul>
+        {c.exchanges.map(e => (
+          <li>{e.baseUrl} <button className="pure-button button-destructive" onClick={() => this.confirmRemoveExchange(c, e)}>Remove</button>
+          </li>
+        ))}
+        </ul>
+      </div>
+    );
+  }
+
+  render(): JSX.Element {
+    let currencies = this.state.currencies;
+    if (!currencies) {
+      return <span>...</span>;
+    }
+    return (
+      <div id="main">
+      {currencies.map(c => (
+        <div>
+          <h1>Currency {c.name}</h1>
+          <p>Displayed with {c.fractionalDigits} fractional digits.</p>
+          <h2>Auditors</h2>
+          <div>{this.renderAuditors(c)}</div>
+          <h2>Exchanges</h2>
+          <div>{this.renderExchanges(c)}</div>
+        </div>
+      ))}
+      </div>
+    );
+  }
+}
+
+export function main() {
+  ReactDOM.render(<CurrencyList />, document.getElementById("container")!);
+}
+
+document.addEventListener("DOMContentLoaded", main);
diff --git a/src/webex/pages/confirm-contract.html b/src/webex/pages/confirm-contract.html
new file mode 100644
index 000000000..6713b2e2c
--- /dev/null
+++ b/src/webex/pages/confirm-contract.html
@@ -0,0 +1,69 @@
+<!DOCTYPE html>
+<html>
+
+<head>
+  <meta charset="UTF-8">
+  <title>Taler Wallet: Confirm Reserve Creation</title>
+
+  <link rel="stylesheet" type="text/css" href="/src/style/wallet.css">
+
+  <link rel="icon" href="/img/icon.png">
+
+  <script src="/dist/page-common-bundle.js"></script>
+  <script src="/dist/confirm-contract-bundle.js"></script>
+
+  <style>
+    button.accept {
+      background-color: #5757D2;
+      border: 1px solid black;
+      border-radius: 5px;
+      margin: 1em 0;
+      padding: 0.5em;
+      font-weight: bold;
+      color: white;
+    }
+    button.linky {
+      background:none!important;
+      border:none;
+      padding:0!important;
+
+      font-family:arial,sans-serif;
+      color:#069;
+      text-decoration:underline;
+      cursor:pointer;
+    }
+
+    input.url {
+      width: 25em;
+    }
+
+
+    button.accept:disabled {
+      background-color: #dedbe8;
+      border: 1px solid white;
+      border-radius: 5px;
+      margin: 1em 0;
+      padding: 0.5em;
+      font-weight: bold;
+      color: #2C2C2C;
+    }
+
+    .errorbox {
+      border: 1px solid;
+      display: inline-block;
+      margin: 1em;
+      padding: 1em;
+      font-weight: bold;
+      background: #FF8A8A;
+    }
+  </style>
+</head>
+
+<body>
+  <section id="main">
+    <h1>GNU Taler Wallet</h1>
+    <article id="contract" class="fade"></article>
+  </section>
+</body>
+
+</html>
diff --git a/src/webex/pages/confirm-contract.tsx b/src/webex/pages/confirm-contract.tsx
new file mode 100644
index 000000000..011df27a1
--- /dev/null
+++ b/src/webex/pages/confirm-contract.tsx
@@ -0,0 +1,242 @@
+/*
+ This file is part of TALER
+ (C) 2015 GNUnet e.V.
+
+ TALER is free software; you can redistribute it and/or modify it under the
+ terms of the GNU General Public License as published by the Free Software
+ Foundation; either version 3, or (at your option) any later version.
+
+ TALER is distributed in the hope that it will be useful, but WITHOUT ANY
+ WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR
+ A PARTICULAR PURPOSE.  See the GNU General Public License for more details.
+
+ You should have received a copy of the GNU General Public License along with
+ TALER; see the file COPYING.  If not, see <http://www.gnu.org/licenses/>
+ */
+
+/**
+ * Page shown to the user to confirm entering
+ * a contract.
+ */
+
+
+/**
+ * Imports.
+ */
+import * as i18n from "../../i18n";
+import { Contract, AmountJson, ExchangeRecord } from "../../types";
+import { OfferRecord } from "../../wallet";
+
+import { renderContract } from "../renderHtml";
+import { getExchanges } from "../wxApi";
+
+import * as React from "react";
+import * as ReactDOM from "react-dom";
+import URI = require("urijs");
+
+
+interface DetailState {
+  collapsed: boolean;
+}
+
+interface DetailProps {
+  contract: Contract
+  collapsed: boolean
+  exchanges: null|ExchangeRecord[];
+}
+
+
+class Details extends React.Component<DetailProps, DetailState> {
+  constructor(props: DetailProps) {
+    super(props);
+    console.log("new Details component created");
+    this.state = {
+      collapsed: props.collapsed,
+    };
+
+    console.log("initial state:", this.state);
+  }
+
+  render() {
+    if (this.state.collapsed) {
+      return (
+        <div>
+          <button className="linky"
+                  onClick={() => { this.setState({collapsed: false} as any)}}>
+          <i18n.Translate wrap="span">
+            show more details
+          </i18n.Translate>
+          </button>
+        </div>
+      );
+    } else {
+      return (
+        <div>
+          <button className="linky"
+                  onClick={() => this.setState({collapsed: true} as any)}>
+            show less details
+          </button>
+          <div>
+            {i18n.str`Accepted exchanges:`}
+            <ul>
+              {this.props.contract.exchanges.map(
+                e => <li>{`${e.url}: ${e.master_pub}`}</li>)}
+            </ul>
+            {i18n.str`Exchanges in the wallet:`}
+            <ul>
+              {(this.props.exchanges || []).map(
+                (e: ExchangeRecord) =>
+                  <li>{`${e.baseUrl}: ${e.masterPublicKey}`}</li>)}
+            </ul>
+          </div>
+        </div>);
+    }
+  }
+}
+
+interface ContractPromptProps {
+  offerId: number;
+}
+
+interface ContractPromptState {
+  offer: OfferRecord|null;
+  error: string|null;
+  payDisabled: boolean;
+  exchanges: null|ExchangeRecord[];
+}
+
+class ContractPrompt extends React.Component<ContractPromptProps, ContractPromptState> {
+  constructor() {
+    super();
+    this.state = {
+      offer: null,
+      error: null,
+      payDisabled: true,
+      exchanges: null
+    }
+  }
+
+  componentWillMount() {
+    this.update();
+  }
+
+  componentWillUnmount() {
+    // FIXME: abort running ops
+  }
+
+  async update() {
+    let offer = await this.getOffer();
+    this.setState({offer} as any);
+    this.checkPayment();
+    let exchanges = await getExchanges();
+    this.setState({exchanges} as any);
+  }
+
+  getOffer(): Promise<OfferRecord> {
+    return new Promise<OfferRecord>((resolve, reject) => {
+      let msg = {
+        type: 'get-offer',
+        detail: {
+          offerId: this.props.offerId
+        }
+      };
+      chrome.runtime.sendMessage(msg, (resp) => {
+        resolve(resp);
+      });
+    })
+  }
+
+  checkPayment() {
+    let msg = {
+      type: 'check-pay',
+      detail: {
+        offer: this.state.offer
+      }
+    };
+    chrome.runtime.sendMessage(msg, (resp) => {
+      if (resp.error) {
+        console.log("check-pay error", JSON.stringify(resp));
+        switch (resp.error) {
+          case "coins-insufficient":
+            let msgInsufficient = i18n.str`You have insufficient funds of the requested currency in your wallet.`;
+            let msgNoMatch = i18n.str`You do not have any funds from an exchange that is accepted by this merchant. None of the exchanges accepted by the merchant is known to your wallet.`;
+            if (this.state.exchanges && this.state.offer) {
+              let acceptedExchangePubs = this.state.offer.contract.exchanges.map((e) => e.master_pub);
+              let ex = this.state.exchanges.find((e) => acceptedExchangePubs.indexOf(e.masterPublicKey) >= 0);
+              if (ex) {
+                this.setState({error: msgInsufficient});
+              } else {
+                this.setState({error: msgNoMatch});
+              }
+            } else {
+              this.setState({error: msgInsufficient});
+            }
+            break;
+          default:
+            this.setState({error: `Error: ${resp.error}`});
+            break;
+        }
+        this.setState({payDisabled: true});
+      } else {
+        this.setState({payDisabled: false, error: null});
+      }
+      this.setState({} as any);
+      window.setTimeout(() => this.checkPayment(), 500);
+    });
+  }
+
+  doPayment() {
+    let d = {offer: this.state.offer};
+    chrome.runtime.sendMessage({type: 'confirm-pay', detail: d}, (resp) => {
+      if (resp.error) {
+        console.log("confirm-pay error", JSON.stringify(resp));
+        switch (resp.error) {
+          case "coins-insufficient":
+            this.setState({error: "You do not have enough coins of the requested currency."});
+            break;
+          default:
+            this.setState({error: `Error: ${resp.error}`});
+            break;
+        }
+        return;
+      }
+      let c = d.offer!.contract;
+      console.log("contract", c);
+      document.location.href = c.fulfillment_url;
+    });
+  }
+
+
+  render() {
+    if (!this.state.offer) {
+      return <span>...</span>;
+    }
+    let c = this.state.offer.contract;
+    return (
+      <div>
+        <div>
+          {renderContract(c)}
+        </div>
+        <button onClick={() => this.doPayment()}
+                disabled={this.state.payDisabled}
+                className="accept">
+          Confirm payment
+        </button>
+        <div>
+          {(this.state.error ? <p className="errorbox">{this.state.error}</p> : <p />)}
+        </div>
+        <Details exchanges={this.state.exchanges} contract={c} collapsed={!this.state.error}/>
+      </div>
+    );
+  }
+}
+
+
+document.addEventListener("DOMContentLoaded", () => {
+  let url = new URI(document.location.href);
+  let query: any = URI.parseQuery(url.query());
+  let offerId = JSON.parse(query.offerId);
+
+  ReactDOM.render(<ContractPrompt offerId={offerId}/>, document.getElementById(
+    "contract")!);
+});
diff --git a/src/webex/pages/confirm-create-reserve.html b/src/webex/pages/confirm-create-reserve.html
new file mode 100644
index 000000000..16ab12a30
--- /dev/null
+++ b/src/webex/pages/confirm-create-reserve.html
@@ -0,0 +1,52 @@
+<!DOCTYPE html>
+<html>
+
+<head>
+  <meta charset="UTF-8">
+  <title>Taler Wallet: Select Taler Provider</title>
+
+  <link rel="icon" href="/img/icon.png">
+  <link rel="stylesheet" type="text/css" href="/src/style/wallet.css">
+  <link rel="stylesheet" type="text/css" href="/src/style/pure.css">
+
+  <script src="/dist/page-common-bundle.js"></script>
+  <script src="/dist/confirm-create-reserve-bundle.js"></script>
+
+  <style>
+    body {
+      font-size: 100%;
+      overflow-y: scroll;
+    }
+    .button-success {
+      background: rgb(28, 184, 65); /* this is a green */
+      color: white;
+      border-radius: 4px;
+      text-shadow: 0 1px 1px rgba(0, 0, 0, 0.2);
+    }
+    .button-secondary {
+      background: rgb(66, 184, 221); /* this is a light blue */
+      color: white;
+      border-radius: 4px;
+      text-shadow: 0 1px 1px rgba(0, 0, 0, 0.2);
+    }
+    a.opener  {
+      color: black;
+    }
+    .opener-open::before {
+      content: "\25bc"
+    }
+    .opener-collapsed::before {
+      content: "\25b6 "
+    }
+  </style>
+
+</head>
+
+<body>
+  <section id="main">
+    <h1>GNU Taler Wallet</h1>
+      <div class="fade" id="exchange-selection"></div>
+  </section>
+</body>
+
+</html>
diff --git a/src/webex/pages/confirm-create-reserve.tsx b/src/webex/pages/confirm-create-reserve.tsx
new file mode 100644
index 000000000..6ece92e21
--- /dev/null
+++ b/src/webex/pages/confirm-create-reserve.tsx
@@ -0,0 +1,641 @@
+/*
+ This file is part of TALER
+ (C) 2015-2016 GNUnet e.V.
+
+ TALER is free software; you can redistribute it and/or modify it under the
+ terms of the GNU General Public License as published by the Free Software
+ Foundation; either version 3, or (at your option) any later version.
+
+ TALER is distributed in the hope that it will be useful, but WITHOUT ANY
+ WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR
+ A PARTICULAR PURPOSE.  See the GNU General Public License for more details.
+
+ You should have received a copy of the GNU General Public License along with
+ TALER; see the file COPYING.  If not, see <http://www.gnu.org/licenses/>
+ */
+
+
+/**
+ * Page shown to the user to confirm creation
+ * of a reserve, usually requested by the bank.
+ *
+ * @author Florian Dold
+ */
+
+import {amountToPretty, canonicalizeBaseUrl} from "../../helpers";
+import {
+  AmountJson, CreateReserveResponse,
+  ReserveCreationInfo, Amounts,
+  Denomination, DenominationRecord, CurrencyRecord
+} from "../../types";
+import * as i18n from "../../i18n";
+
+import {getReserveCreationInfo, getCurrency, getExchangeInfo} from "../wxApi";
+import {ImplicitStateComponent, StateHolder} from "../components";
+
+import * as React from "react";
+import * as ReactDOM from "react-dom";
+import URI = require("urijs");
+import * as moment from "moment";
+
+
+function delay<T>(delayMs: number, value: T): Promise<T> {
+  return new Promise<T>((resolve, reject) => {
+    setTimeout(() => resolve(value), delayMs);
+  });
+}
+
+class EventTrigger {
+  triggerResolve: any;
+  triggerPromise: Promise<boolean>;
+
+  constructor() {
+    this.reset();
+  }
+
+  private reset() {
+    this.triggerPromise = new Promise<boolean>((resolve, reject) => {
+      this.triggerResolve = resolve;
+    });
+  }
+
+  trigger() {
+    this.triggerResolve(false);
+    this.reset();
+  }
+
+  async wait(delayMs: number): Promise<boolean> {
+    return await Promise.race([this.triggerPromise, delay(delayMs, true)]);
+  }
+}
+
+
+interface CollapsibleState {
+  collapsed: boolean;
+}
+
+interface CollapsibleProps {
+  initiallyCollapsed: boolean;
+  title: string;
+}
+
+class Collapsible extends React.Component<CollapsibleProps, CollapsibleState> {
+  constructor(props: CollapsibleProps) {
+    super(props);
+    this.state = { collapsed: props.initiallyCollapsed };
+  }
+  render() {
+    const doOpen = (e: any) => {
+      this.setState({collapsed: false})
+      e.preventDefault()
+    };
+    const doClose = (e: any) => {
+      this.setState({collapsed: true})
+      e.preventDefault();
+    };
+    if (this.state.collapsed) {
+      return <h2><a className="opener opener-collapsed" href="#" onClick={doOpen}>{this.props.title}</a></h2>;
+    }
+    return (
+      <div>
+        <h2><a className="opener opener-open" href="#" onClick={doClose}>{this.props.title}</a></h2>
+        {this.props.children}
+      </div>
+    );
+  }
+}
+
+function renderAuditorDetails(rci: ReserveCreationInfo|null) {
+  if (!rci) {
+    return (
+      <p>
+        Details will be displayed when a valid exchange provider URL is entered.
+      </p>
+    );
+  }
+  if (rci.exchangeInfo.auditors.length == 0) {
+    return (
+      <p>
+        The exchange is not audited by any auditors.
+      </p>
+    );
+  }
+  return (
+    <div>
+      {rci.exchangeInfo.auditors.map(a => (
+        <h3>Auditor {a.url}</h3>
+      ))}
+    </div>
+  );
+}
+
+function renderReserveCreationDetails(rci: ReserveCreationInfo|null) {
+  if (!rci) {
+    return (
+      <p>
+        Details will be displayed when a valid exchange provider URL is entered.
+      </p>
+    );
+  }
+
+  let denoms = rci.selectedDenoms;
+
+  let countByPub: {[s: string]: number} = {};
+  let uniq: DenominationRecord[] = [];
+
+  denoms.forEach((x: DenominationRecord) => {
+    let c = countByPub[x.denomPub] || 0;
+    if (c == 0) {
+      uniq.push(x);
+    }
+    c += 1;
+    countByPub[x.denomPub] = c;
+  });
+
+  function row(denom: DenominationRecord) {
+    return (
+      <tr>
+        <td>{countByPub[denom.denomPub] + "x"}</td>
+        <td>{amountToPretty(denom.value)}</td>
+        <td>{amountToPretty(denom.feeWithdraw)}</td>
+        <td>{amountToPretty(denom.feeRefresh)}</td>
+        <td>{amountToPretty(denom.feeDeposit)}</td>
+      </tr>
+    );
+  }
+
+  function wireFee(s: string) {
+    return [
+      <thead>
+        <tr>
+        <th colSpan={3}>Wire Method {s}</th>
+        </tr>
+        <tr>
+        <th>Applies Until</th>
+        <th>Wire Fee</th>
+        <th>Closing Fee</th>
+        </tr>
+      </thead>,
+      <tbody>
+      {rci!.wireFees.feesForType[s].map(f => (
+        <tr>
+          <td>{moment.unix(f.endStamp).format("llll")}</td>
+          <td>{amountToPretty(f.wireFee)}</td>
+          <td>{amountToPretty(f.closingFee)}</td>
+        </tr>
+      ))}
+      </tbody>
+    ];
+  }
+
+  let withdrawFeeStr = amountToPretty(rci.withdrawFee);
+  let overheadStr = amountToPretty(rci.overhead);
+
+  return (
+    <div>
+      <h3>Overview</h3>
+      <p>{i18n.str`Withdrawal fees: ${withdrawFeeStr}`}</p>
+      <p>{i18n.str`Rounding loss: ${overheadStr}`}</p>
+      <p>{i18n.str`Earliest expiration (for deposit): ${moment.unix(rci.earliestDepositExpiration).fromNow()}`}</p>
+      <h3>Coin Fees</h3>
+      <table className="pure-table">
+        <thead>
+        <tr>
+          <th>{i18n.str`# Coins`}</th>
+          <th>{i18n.str`Value`}</th>
+          <th>{i18n.str`Withdraw Fee`}</th>
+          <th>{i18n.str`Refresh Fee`}</th>
+          <th>{i18n.str`Deposit Fee`}</th>
+        </tr>
+        </thead>
+        <tbody>
+        {uniq.map(row)}
+        </tbody>
+      </table>
+      <h3>Wire Fees</h3>
+      <table className="pure-table">
+      {Object.keys(rci.wireFees.feesForType).map(wireFee)}
+      </table>
+    </div>
+  );
+}
+
+
+function getSuggestedExchange(currency: string): Promise<string> {
+  // TODO: make this request go to the wallet backend
+  // Right now, this is a stub.
+  const defaultExchange: {[s: string]: string} = {
+    "KUDOS": "https://exchange.demo.taler.net",
+    "PUDOS": "https://exchange.test.taler.net",
+  };
+
+  let exchange = defaultExchange[currency];
+
+  if (!exchange) {
+    exchange = ""
+  }
+
+  return Promise.resolve(exchange);
+}
+
+
+function WithdrawFee(props: {reserveCreationInfo: ReserveCreationInfo|null}): JSX.Element {
+  if (props.reserveCreationInfo) {
+    let {overhead, withdrawFee} = props.reserveCreationInfo;
+    let totalCost = Amounts.add(overhead, withdrawFee).amount;
+    return <p>{i18n.str`Withdraw fees:`} {amountToPretty(totalCost)}</p>;
+  }
+  return <p />;
+}
+
+
+interface ExchangeSelectionProps {
+  suggestedExchangeUrl: string;
+  amount: AmountJson;
+  callback_url: string;
+  wt_types: string[];
+  currencyRecord: CurrencyRecord|null;
+}
+
+interface ManualSelectionProps {
+  onSelect(url: string): void;
+  initialUrl: string;
+}
+
+class ManualSelection extends ImplicitStateComponent<ManualSelectionProps> {
+  url: StateHolder<string> = this.makeState("");
+  errorMessage: StateHolder<string|null> = this.makeState(null);
+  isOkay: StateHolder<boolean> = this.makeState(false);
+  updateEvent = new EventTrigger();
+  constructor(p: ManualSelectionProps) {
+    super(p);
+    this.url(p.initialUrl);
+    this.update();
+  }
+  render() {
+    return (
+      <div className="pure-g pure-form pure-form-stacked">
+        <div className="pure-u-1">
+          <label>URL</label>
+          <input className="url" type="text" spellCheck={false}
+                 value={this.url()}
+                 key="exchange-url-input"
+                 onInput={(e) => this.onUrlChanged((e.target as HTMLInputElement).value)} />
+        </div>
+        <div className="pure-u-1">
+          <button className="pure-button button-success"
+                  disabled={!this.isOkay()}
+                  onClick={() => this.props.onSelect(this.url())}>
+            {i18n.str`Select`}
+          </button>
+          {this.errorMessage()}
+        </div>
+      </div>
+    );
+  }
+
+  async update() {
+    this.errorMessage(null);
+    this.isOkay(false);
+    if (!this.url()) {
+      return;
+    }
+    let parsedUrl = new URI(this.url()!);
+    if (parsedUrl.is("relative")) {
+      this.errorMessage(i18n.str`Error: URL may not be relative`);
+      this.isOkay(false);
+      return;
+    }
+    try {
+      let url = canonicalizeBaseUrl(this.url()!);
+      let r = await getExchangeInfo(url)
+      console.log("getExchangeInfo returned")
+      this.isOkay(true);
+    } catch (e) {
+      console.log("got error", e);
+      if (e.hasOwnProperty("httpStatus")) {
+        this.errorMessage(`Error: request failed with status ${e.httpStatus}`);
+      } else if (e.hasOwnProperty("errorResponse")) {
+        let resp = e.errorResponse;
+        this.errorMessage(`Error: ${resp.error} (${resp.hint})`);
+      } else {
+        this.errorMessage("invalid exchange URL");
+      }
+    }
+  }
+
+  async onUrlChanged(s: string) {
+    this.url(s);
+    this.errorMessage(null);
+    this.isOkay(false);
+    this.updateEvent.trigger();
+    let waited = await this.updateEvent.wait(200);
+    if (waited) {
+      // Run the actual update if nobody else preempted us.
+      this.update();
+    }
+  }
+}
+
+
+class ExchangeSelection extends ImplicitStateComponent<ExchangeSelectionProps> {
+  statusString: StateHolder<string|null> = this.makeState(null);
+  reserveCreationInfo: StateHolder<ReserveCreationInfo|null> = this.makeState(
+    null);
+  url: StateHolder<string|null> = this.makeState(null);
+
+  selectingExchange: StateHolder<boolean> = this.makeState(false);
+
+  constructor(props: ExchangeSelectionProps) {
+    super(props);
+    let prefilledExchangesUrls = [];
+    if (props.currencyRecord) {
+      let exchanges = props.currencyRecord.exchanges.map((x) => x.baseUrl);
+      prefilledExchangesUrls.push(...exchanges);
+    }
+    if (props.suggestedExchangeUrl) {
+      prefilledExchangesUrls.push(props.suggestedExchangeUrl);
+    }
+    if (prefilledExchangesUrls.length != 0) {
+      this.url(prefilledExchangesUrls[0]);
+      this.forceReserveUpdate();
+    } else {
+      this.selectingExchange(true);
+    }
+  }
+
+  renderFeeStatus() {
+    let rci = this.reserveCreationInfo();
+    if (rci) {
+      let totalCost = Amounts.add(rci.overhead, rci.withdrawFee).amount;
+      let trustMessage;
+      if (rci.isTrusted) {
+        trustMessage = (
+          <i18n.Translate wrap="p">
+            The exchange is trusted by the wallet.
+          </i18n.Translate>
+        );
+      } else if (rci.isAudited) {
+        trustMessage = (
+          <i18n.Translate wrap="p">
+            The exchange is audited by a trusted auditor.
+          </i18n.Translate>
+        );
+      } else {
+        trustMessage = (
+          <i18n.Translate wrap="p">
+            Warning:  The exchange is neither directly trusted nor audited by a trusted auditor.
+            If you withdraw from this exchange, it will be trusted in the future.
+          </i18n.Translate>
+        );
+      }
+      return (
+        <div>
+        <i18n.Translate wrap="p">
+          Using exchange provider <strong>{this.url()}</strong>.
+          The exchange provider will charge
+          {" "}
+          <span>{amountToPretty(totalCost)}</span>
+          {" "}
+          in fees.
+        </i18n.Translate>
+        {trustMessage}
+        </div>
+      );
+    }
+    if (this.url() && !this.statusString()) {
+      let shortName = new URI(this.url()!).host();
+      return (
+        <i18n.Translate wrap="p">
+          Waiting for a response from
+          {" "}
+          <em>{shortName}</em>
+        </i18n.Translate>
+      );
+    }
+    if (this.statusString()) {
+      return (
+        <p>
+          <strong style={{color: "red"}}>{i18n.str`A problem occured, see below. ${this.statusString()}`}</strong>
+        </p>
+      );
+    }
+    return (
+      <p>
+        {i18n.str`Information about fees will be available when an exchange provider is selected.`}
+      </p>
+    );
+  }
+
+  renderConfirm() {
+    return (
+      <div>
+        {this.renderFeeStatus()}
+        <button className="pure-button button-success"
+                disabled={this.reserveCreationInfo() == null}
+                onClick={() => this.confirmReserve()}>
+          {i18n.str`Accept fees and withdraw`}
+        </button>
+        { " " }
+        <button className="pure-button button-secondary"
+                onClick={() => this.selectingExchange(true)}>
+          {i18n.str`Change Exchange Provider`}
+        </button>
+        <br/>
+        <Collapsible initiallyCollapsed={true} title="Fee and Spending Details">
+          {renderReserveCreationDetails(this.reserveCreationInfo())}
+        </Collapsible>
+        <Collapsible initiallyCollapsed={true} title="Auditor Details">
+          {renderAuditorDetails(this.reserveCreationInfo())}
+        </Collapsible>
+      </div>
+    );
+  }
+
+  select(url: string) {
+    this.reserveCreationInfo(null);
+    this.url(url);
+    this.selectingExchange(false);
+    this.forceReserveUpdate();
+  }
+
+  renderSelect() {
+    let exchanges = (this.props.currencyRecord && this.props.currencyRecord.exchanges) || [];
+    console.log(exchanges);
+    return (
+      <div>
+        Please select an exchange.  You can review the details before after your selection.
+
+        {this.props.suggestedExchangeUrl && (
+          <div>
+            <h2>Bank Suggestion</h2>
+            <button className="pure-button button-success" onClick={() => this.select(this.props.suggestedExchangeUrl)}>
+              Select <strong>{this.props.suggestedExchangeUrl}</strong>
+            </button>
+          </div>
+        )}
+
+        {exchanges.length > 0 && (
+          <div>
+            <h2>Known Exchanges</h2>
+            {exchanges.map(e => (
+              <button className="pure-button button-success" onClick={() => this.select(e.baseUrl)}>
+              Select <strong>{e.baseUrl}</strong>
+              </button>
+            ))}
+          </div>
+        )}
+
+        <h2>Manual Selection</h2>
+        <ManualSelection initialUrl={this.url() || ""} onSelect={(url: string) => this.select(url)} />
+      </div>
+    );
+  }
+
+  render(): JSX.Element {
+    return (
+      <div>
+        <i18n.Translate wrap="p">
+          {"You are about to withdraw "}
+          <strong>{amountToPretty(this.props.amount)}</strong>
+          {" from your bank account into your wallet."}
+        </i18n.Translate>
+        {this.selectingExchange() ? this.renderSelect() : this.renderConfirm()}
+      </div>
+    );
+  }
+
+
+  confirmReserve() {
+    this.confirmReserveImpl(this.reserveCreationInfo()!,
+                            this.url()!,
+                            this.props.amount,
+                            this.props.callback_url);
+  }
+
+  /**
+   * Do an update of the reserve creation info, without any debouncing.
+   */
+  async forceReserveUpdate() {
+    this.reserveCreationInfo(null);
+    try {
+      let url = canonicalizeBaseUrl(this.url()!);
+      let r = await getReserveCreationInfo(url,
+                                           this.props.amount);
+      console.log("get exchange info resolved");
+      this.reserveCreationInfo(r);
+      console.dir(r);
+    } catch (e) {
+      console.log("get exchange info rejected", e);
+      if (e.hasOwnProperty("httpStatus")) {
+        this.statusString(`Error: request failed with status ${e.httpStatus}`);
+      } else if (e.hasOwnProperty("errorResponse")) {
+        let resp = e.errorResponse;
+        this.statusString(`Error: ${resp.error} (${resp.hint})`);
+      }
+    }
+  }
+
+  confirmReserveImpl(rci: ReserveCreationInfo,
+                     exchange: string,
+                     amount: AmountJson,
+                     callback_url: string) {
+    const d = {exchange: canonicalizeBaseUrl(exchange), amount};
+    const cb = (rawResp: any) => {
+      if (!rawResp) {
+        throw Error("empty response");
+      }
+      // FIXME: filter out types that bank/exchange don't have in common
+      let wireDetails = rci.wireInfo;
+      let filteredWireDetails: any = {};
+      for (let wireType in wireDetails) {
+        if (this.props.wt_types.findIndex((x) => x.toLowerCase() == wireType.toLowerCase()) < 0) {
+          continue;
+        }
+        let obj = Object.assign({}, wireDetails[wireType]);
+        // The bank doesn't need to know about fees
+        delete obj.fees;
+        // Consequently the bank can't verify signatures anyway, so
+        // we delete this extra data, to make the request URL shorter.
+        delete obj.salt;
+        delete obj.sig;
+        filteredWireDetails[wireType] = obj;
+      }
+      if (!rawResp.error) {
+        const resp = CreateReserveResponse.checked(rawResp);
+        let q: {[name: string]: string|number} = {
+          wire_details: JSON.stringify(filteredWireDetails),
+          exchange: resp.exchange,
+          reserve_pub: resp.reservePub,
+          amount_value: amount.value,
+          amount_fraction: amount.fraction,
+          amount_currency: amount.currency,
+        };
+        let url = new URI(callback_url).addQuery(q);
+        if (!url.is("absolute")) {
+          throw Error("callback url is not absolute");
+        }
+        console.log("going to", url.href());
+        document.location.href = url.href();
+      } else {
+        this.statusString(
+          i18n.str`Oops, something went wrong. The wallet responded with error status (${rawResp.error}).`);
+      }
+    };
+    chrome.runtime.sendMessage({type: 'create-reserve', detail: d}, cb);
+  }
+
+  renderStatus(): any {
+    if (this.statusString()) {
+      return <p><strong style={{color: "red"}}>{this.statusString()}</strong></p>;
+    } else if (!this.reserveCreationInfo()) {
+      return <p>{i18n.str`Checking URL, please wait ...`}</p>;
+    }
+    return "";
+  }
+}
+
+export async function main() {
+  try {
+    const url = new URI(document.location.href);
+    const query: any = URI.parseQuery(url.query());
+    let amount;
+    try {
+      amount = AmountJson.checked(JSON.parse(query.amount));
+    } catch (e) {
+      throw Error(i18n.str`Can't parse amount: ${e.message}`);
+    }
+    const callback_url = query.callback_url;
+    const bank_url = query.bank_url;
+    let wt_types;
+    try {
+      wt_types = JSON.parse(query.wt_types);
+    } catch (e) {
+      throw Error(i18n.str`Can't parse wire_types: ${e.message}`);
+    }
+
+    let suggestedExchangeUrl = query.suggested_exchange_url;
+    let currencyRecord = await getCurrency(amount.currency);
+
+    let args = {
+      wt_types,
+      suggestedExchangeUrl,
+      callback_url,
+      amount,
+      currencyRecord,
+    };
+
+    ReactDOM.render(<ExchangeSelection {...args} />, document.getElementById(
+      "exchange-selection")!);
+
+  } catch (e) {
+    // TODO: provide more context information, maybe factor it out into a
+    // TODO:generic error reporting function or component.
+    document.body.innerText = i18n.str`Fatal error: "${e.message}".`;
+    console.error(`got error "${e.message}"`, e);
+  }
+}
+
+document.addEventListener("DOMContentLoaded", () => {
+  main();
+});
diff --git a/src/webex/pages/error.html b/src/webex/pages/error.html
new file mode 100644
index 000000000..51a8fd73a
--- /dev/null
+++ b/src/webex/pages/error.html
@@ -0,0 +1,18 @@
+<!DOCTYPE html>
+<html>
+
+<head>
+  <meta charset="UTF-8">
+  <title>Taler Wallet: Error Occured</title>
+
+  <link rel="stylesheet" type="text/css" href="../style/wallet.css">
+
+  <link rel="icon" href="/img/icon.png">
+
+  <script src="/dist/page-common-bundle.js"></script>
+  <script src="/dist/error-bundle.js"></script>
+
+  <body>
+    <div id="container"></div>
+  </body>
+</html>
diff --git a/src/webex/pages/error.tsx b/src/webex/pages/error.tsx
new file mode 100644
index 000000000..f278bd224
--- /dev/null
+++ b/src/webex/pages/error.tsx
@@ -0,0 +1,63 @@
+/*
+ This file is part of TALER
+ (C) 2015-2016 GNUnet e.V.
+
+ TALER is free software; you can redistribute it and/or modify it under the
+ terms of the GNU General Public License as published by the Free Software
+ Foundation; either version 3, or (at your option) any later version.
+
+ TALER is distributed in the hope that it will be useful, but WITHOUT ANY
+ WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR
+ A PARTICULAR PURPOSE.  See the GNU General Public License for more details.
+
+ You should have received a copy of the GNU General Public License along with
+ TALER; see the file COPYING.  If not, see <http://www.gnu.org/licenses/>
+ */
+
+
+/**
+ * Page shown to the user to confirm creation
+ * of a reserve, usually requested by the bank.
+ *
+ * @author Florian Dold
+ */
+
+import {ImplicitStateComponent, StateHolder} from "../components";
+
+import * as React from "react";
+import * as ReactDOM from "react-dom";
+import URI = require("urijs");
+
+"use strict";
+
+interface ErrorProps {
+  message: string;
+}
+
+class ErrorView extends React.Component<ErrorProps, void> {
+  render(): JSX.Element {
+    return (
+      <div>
+        An error occurred: {this.props.message}
+      </div>
+    );
+  }
+}
+
+export async function main() {
+  try {
+    const url = new URI(document.location.href);
+    const query: any = URI.parseQuery(url.query());
+
+    const message: string = query.message || "unknown error";
+
+    ReactDOM.render(<ErrorView message={message} />, document.getElementById(
+      "container")!);
+
+  } catch (e) {
+    // TODO: provide more context information, maybe factor it out into a
+    // TODO:generic error reporting function or component.
+    document.body.innerText = `Fatal error: "${e.message}".`;
+    console.error(`got error "${e.message}"`, e);
+  }
+}
diff --git a/src/webex/pages/help/empty-wallet.html b/src/webex/pages/help/empty-wallet.html
new file mode 100644
index 000000000..dd29d9689
--- /dev/null
+++ b/src/webex/pages/help/empty-wallet.html
@@ -0,0 +1,30 @@
+<!DOCTYPE html>
+<html>
+  <head>
+    <meta charset="utf-8">
+    <title>GNU Taler Help - Empty Wallet</title>
+    <link rel="icon" href="/img/icon.png">
+    <meta name="description" content="">
+    <link rel="stylesheet" type="text/css" href="/src/style/wallet.css">
+  </head>
+  <body>
+    <div class="container" id="main">
+      <div class="row">
+        <div class="col-lg-12">
+          <h2 lang="en">Your wallet is empty!</h2>
+          <p lang="en">You have succeeded with installing the Taler wallet.  However, before
+             you can buy articles using the Taler wallet, you must withdraw electronic coins.
+             This is typically done by visiting your bank's online banking Web site.  There,
+             you instruct your bank to transfer the funds to a Taler exchange operator.  In
+             return, your wallet will be allowed to withdraw electronic coins.</p>
+          <p lang="en">At this stage, we are not aware of any regular exchange operators issuing
+             coins in well-known currencies.  However, to see how Taler would work, you
+             can visit our "fake" bank at
+             <a href="https://bank.demo.taler.net/">bank.demo.taler.net</a> to
+             withdraw coins in the "KUDOS" currency that we created just for
+             demonstrating the system.</p>
+        </div>
+      </div>
+    </div>
+  </body>
+</html>
diff --git a/src/webex/pages/logs.html b/src/webex/pages/logs.html
new file mode 100644
index 000000000..9545269e3
--- /dev/null
+++ b/src/webex/pages/logs.html
@@ -0,0 +1,27 @@
+<!DOCTYPE html>
+<html>
+
+<head>
+  <meta charset="UTF-8">
+  <title>Taler Wallet: Logs</title>
+
+  <link rel="stylesheet" type="text/css" href="../style/wallet.css">
+
+  <link rel="icon" href="/img/icon.png">
+
+  <script src="/dist/page-common-bundle.js"></script>
+  <script src="/dist/logs-bundle.js"></script>
+
+  <style>
+    .tree-item {
+            margin: 2em;
+            border-radius: 5px;
+            border: 1px solid gray;
+            padding: 1em;
+    }
+  </style>
+
+  <body>
+    <div id="container"></div>
+  </body>
+</html>
diff --git a/src/webex/pages/logs.tsx b/src/webex/pages/logs.tsx
new file mode 100644
index 000000000..0c533bfa8
--- /dev/null
+++ b/src/webex/pages/logs.tsx
@@ -0,0 +1,83 @@
+/*
+ This file is part of TALER
+ (C) 2016 Inria
+
+ TALER is free software; you can redistribute it and/or modify it under the
+ terms of the GNU General Public License as published by the Free Software
+ Foundation; either version 3, or (at your option) any later version.
+
+ TALER is distributed in the hope that it will be useful, but WITHOUT ANY
+ WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR
+ A PARTICULAR PURPOSE.  See the GNU General Public License for more details.
+
+ You should have received a copy of the GNU General Public License along with
+ TALER; see the file COPYING.  If not, see <http://www.gnu.org/licenses/>
+ */
+
+/**
+ * Show wallet logs.
+ *
+ * @author Florian Dold
+ */
+
+import {LogEntry, getLogs} from "../../logging";
+
+import * as React from "react";
+import * as ReactDOM from "react-dom";
+
+interface LogViewProps {
+  log: LogEntry;
+}
+
+class LogView extends React.Component<LogViewProps, void> {
+  render(): JSX.Element {
+    let e = this.props.log;
+    return (
+      <div className="tree-item">
+        <ul>
+          <li>level: {e.level}</li>
+          <li>msg: {e.msg}</li>
+          <li>id: {e.id || "unknown"}</li>
+          <li>file: {e.source || "(unknown)"}</li>
+          <li>line: {e.line || "(unknown)"}</li>
+          <li>col: {e.col || "(unknown)"}</li>
+          {(e.detail ? <li> detail: <pre>{e.detail}</pre></li> : [])}
+        </ul>
+      </div>
+    );
+  }
+}
+
+interface LogsState {
+  logs: LogEntry[]|undefined;
+}
+
+class Logs extends React.Component<any, LogsState> {
+  constructor() {
+    super();
+    this.update();
+    this.state = {} as any;
+  }
+
+  async update() {
+    let logs = await getLogs();
+    this.setState({logs});
+  }
+
+  render(): JSX.Element {
+    let logs = this.state.logs;
+    if (!logs) {
+      return <span>...</span>;
+    }
+    return (
+      <div className="tree-item">
+        Logs:
+        {logs.map(e => <LogView log={e} />)}
+      </div>
+    );
+  }
+}
+
+document.addEventListener("DOMContentLoaded", () => {
+  ReactDOM.render(<Logs />, document.getElementById("container")!);
+});
diff --git a/src/webex/pages/payback.html b/src/webex/pages/payback.html
new file mode 100644
index 000000000..d6fe334c8
--- /dev/null
+++ b/src/webex/pages/payback.html
@@ -0,0 +1,36 @@
+<!DOCTYPE html>
+<html>
+
+<head>
+  <meta charset="UTF-8">
+  <title>Taler Wallet: Payback</title>
+
+  <link rel="stylesheet" type="text/css" href="../style/wallet.css">
+
+  <link rel="icon" href="/img/icon.png">
+
+  <script src="/dist/page-common-bundle.js"></script>
+  <script src="/dist/payback-bundle.js"></script>
+
+  <style>
+    body {
+      font-size: 100%;
+    }
+    .tree-item {
+            margin: 2em;
+            border-radius: 5px;
+            border: 1px solid gray;
+            padding: 1em;
+    }
+    .button-linky {
+      background: none;
+      color: black;
+      text-decoration: underline;
+      border: none;
+    }
+  </style>
+
+  <body>
+    <div id="container"></div>
+  </body>
+</html>
diff --git a/src/webex/pages/payback.tsx b/src/webex/pages/payback.tsx
new file mode 100644
index 000000000..7bcc581d8
--- /dev/null
+++ b/src/webex/pages/payback.tsx
@@ -0,0 +1,100 @@
+/*
+ This file is part of TALER
+ (C) 2017 Inria
+
+ TALER is free software; you can redistribute it and/or modify it under the
+ terms of the GNU General Public License as published by the Free Software
+ Foundation; either version 3, or (at your option) any later version.
+
+ TALER is distributed in the hope that it will be useful, but WITHOUT ANY
+ WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR
+ A PARTICULAR PURPOSE.  See the GNU General Public License for more details.
+
+ You should have received a copy of the GNU General Public License along with
+ TALER; see the file COPYING.  If not, see <http://www.gnu.org/licenses/>
+ */
+
+/**
+ * View and edit auditors.
+ *
+ * @author Florian Dold
+ */
+
+
+import { amountToPretty, getTalerStampDate } from "../../helpers";
+import {
+  ExchangeRecord,
+  ExchangeForCurrencyRecord,
+  DenominationRecord,
+  AuditorRecord,
+  CurrencyRecord,
+  ReserveRecord,
+  CoinRecord,
+  PreCoinRecord,
+  Denomination,
+  WalletBalance,
+} from "../../types";
+
+import { ImplicitStateComponent, StateHolder } from "../components";
+import {
+  getCurrencies,
+  updateCurrency,
+  getPaybackReserves,
+  withdrawPaybackReserve,
+} from "../wxApi";
+
+import * as React from "react";
+import * as ReactDOM from "react-dom";
+
+class Payback extends ImplicitStateComponent<any> {
+  reserves: StateHolder<ReserveRecord[]|null> = this.makeState(null);
+  constructor() {
+    super();
+    let port = chrome.runtime.connect();
+    port.onMessage.addListener((msg: any) => {
+      if (msg.notify) {
+        console.log("got notified");
+        this.update();
+      }
+    });
+    this.update();
+  }
+
+  async update() {
+    let reserves = await getPaybackReserves();
+    this.reserves(reserves);
+  }
+
+  withdrawPayback(pub: string) {
+    withdrawPaybackReserve(pub); 
+  }
+
+  render(): JSX.Element {
+    let reserves = this.reserves();
+    if (!reserves) {
+      return <span>loading ...</span>;
+    }
+    if (reserves.length == 0) {
+      return <span>No reserves with payback available.</span>;
+    }
+    return (
+      <div>
+        {reserves.map(r => (
+          <div>
+            <h2>Reserve for ${amountToPretty(r.current_amount!)}</h2>
+            <ul>
+              <li>Exchange: ${r.exchange_base_url}</li>
+            </ul>
+            <button onClick={() => this.withdrawPayback(r.reserve_pub)}>Withdraw again</button>
+          </div>
+        ))}
+      </div>
+    );
+  }
+}
+
+export function main() {
+  ReactDOM.render(<Payback />, document.getElementById("container")!);
+}
+
+document.addEventListener("DOMContentLoaded", main);
diff --git a/src/webex/pages/popup.css b/src/webex/pages/popup.css
new file mode 100644
index 000000000..675412c11
--- /dev/null
+++ b/src/webex/pages/popup.css
@@ -0,0 +1,84 @@
+
+/**
+ * @author Gabor X. Toth
+ * @author Marcello Stanisci
+ * @author Florian Dold
+ */
+
+body {
+    min-height: 20em;
+    width: 30em;
+    margin: 0;
+    padding: 0;
+    max-height: 800px;
+    overflow: hidden;
+}
+
+.nav {
+    background-color: #ddd;
+    padding: 0.5em 0;
+}
+
+.nav a {
+    color: black;
+    padding: 0.5em;
+    text-decoration: none;
+}
+
+.nav a.active {
+    background-color: white;
+    font-weight: bold;
+}
+
+
+.container {
+    overflow-y: scroll;
+    max-height: 400px;
+}
+
+.abbrev {
+    text-decoration-style: dotted;
+}
+
+#content {
+    padding: 1em;
+}
+
+
+#wallet-table .amount {
+    text-align: right;
+}
+
+.hidden {
+    display: none;
+}
+
+#transactions-table th,
+#transactions-table td {
+    padding: 0.2em 0.5em;
+}
+
+#reserve-create table {
+    width: 100%;
+}
+
+#reserve-create table td.label {
+    width: 5em;
+}
+
+#reserve-create table .input input[type="text"] {
+    width: 100%;
+}
+
+.historyItem {
+    border: 1px solid black;
+    border-radius: 10px;
+    padding-left: 0.5em;
+    margin: 0.5em;
+}
+
+.historyDate {
+    font-size: 90%;
+    margin: 0.3em;
+    color: slategray;
+}
diff --git a/src/webex/pages/popup.html b/src/webex/pages/popup.html
new file mode 100644
index 000000000..98f24bccc
--- /dev/null
+++ b/src/webex/pages/popup.html
@@ -0,0 +1,18 @@
+<!DOCTYPE html>
+<html>
+
+<head>
+  <meta charset="utf-8">
+
+  <link rel="stylesheet" type="text/css" href="../style/wallet.css">
+  <link rel="stylesheet" type="text/css" href="popup.css">
+
+  <script src="/dist/page-common-bundle.js"></script>
+  <script src="/dist/popup-bundle.js"></script>
+</head>
+
+<body>
+  <div id="content" style="margin:0;padding:0"></div>
+</body>
+
+</html>
diff --git a/src/webex/pages/popup.tsx b/src/webex/pages/popup.tsx
new file mode 100644
index 000000000..a806cfef9
--- /dev/null
+++ b/src/webex/pages/popup.tsx
@@ -0,0 +1,548 @@
+/*
+ This file is part of TALER
+ (C) 2016 GNUnet e.V.
+
+ TALER is free software; you can redistribute it and/or modify it under the
+ terms of the GNU General Public License as published by the Free Software
+ Foundation; either version 3, or (at your option) any later version.
+
+ TALER is distributed in the hope that it will be useful, but WITHOUT ANY
+ WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR
+ A PARTICULAR PURPOSE.  See the GNU General Public License for more details.
+
+ You should have received a copy of the GNU General Public License along with
+ TALER; see the file COPYING.  If not, see <http://www.gnu.org/licenses/>
+ */
+
+
+/**
+ * Popup shown to the user when they click
+ * the Taler browser action button.
+ *
+ * @author Florian Dold
+ */
+
+
+"use strict";
+
+import {
+  AmountJson,
+  Amounts,
+  WalletBalance,
+  WalletBalanceEntry
+} from "../../types";
+import { HistoryRecord, HistoryLevel } from "../../wallet";
+import { amountToPretty } from "../../helpers";
+import * as i18n from "../../i18n";
+
+import { abbrev } from "../renderHtml";
+
+import * as React from "react";
+import * as ReactDOM from "react-dom";
+import URI = require("urijs");
+
+function onUpdateNotification(f: () => void): () => void {
+  let port = chrome.runtime.connect({name: "notifications"});
+  let listener = (msg: any, port: any) => {
+    f();
+  };
+  port.onMessage.addListener(listener);
+  return () => {
+    port.onMessage.removeListener(listener);
+  }
+}
+
+
+class Router extends React.Component<any,any> {
+  static setRoute(s: string): void {
+    window.location.hash = s;
+  }
+
+  static getRoute(): string {
+    // Omit the '#' at the beginning
+    return window.location.hash.substring(1);
+  }
+
+  static onRoute(f: any): () => void {
+    Router.routeHandlers.push(f);
+    return () => {
+      let i = Router.routeHandlers.indexOf(f);
+      this.routeHandlers = this.routeHandlers.splice(i, 1);
+    }
+  }
+
+  static routeHandlers: any[] = [];
+
+  componentWillMount() {
+    console.log("router mounted");
+    window.onhashchange = () => {
+      this.setState({});
+      for (let f of Router.routeHandlers) {
+        f();
+      }
+    }
+  }
+
+  componentWillUnmount() {
+    console.log("router unmounted");
+  }
+
+
+  render(): JSX.Element {
+    let route = window.location.hash.substring(1);
+    console.log("rendering route", route);
+    let defaultChild: React.ReactChild|null = null;
+    let foundChild: React.ReactChild|null = null;
+    React.Children.forEach(this.props.children, (child) => {
+      let childProps: any = (child as any).props;
+      if (!childProps) {
+        return;
+      }
+      if (childProps["default"]) {
+        defaultChild = child;
+      }
+      if (childProps["route"] == route) {
+        foundChild = child;
+      }
+    })
+    let child: React.ReactChild | null = foundChild || defaultChild;
+    if (!child) {
+      throw Error("unknown route");
+    }
+    Router.setRoute((child as any).props["route"]);
+    return <div>{child}</div>;
+  }
+}
+
+
+interface TabProps {
+  target: string;
+  children?: React.ReactNode;
+}
+
+function Tab(props: TabProps) {
+  let cssClass = "";
+  if (props.target == Router.getRoute()) {
+    cssClass = "active";
+  }
+  let onClick = (e: React.MouseEvent<HTMLAnchorElement>) => {
+    Router.setRoute(props.target);
+    e.preventDefault();
+  };
+  return (
+    <a onClick={onClick} href={props.target} className={cssClass}>
+      {props.children}
+    </a>
+  );
+}
+
+
+class WalletNavBar extends React.Component<any,any> {
+  cancelSubscription: any;
+
+  componentWillMount() {
+    this.cancelSubscription = Router.onRoute(() => {
+      this.setState({});
+    });
+  }
+
+  componentWillUnmount() {
+    if (this.cancelSubscription) {
+      this.cancelSubscription();
+    }
+  }
+
+  render() {
+    console.log("rendering nav bar");
+    return (
+      <div className="nav" id="header">
+        <Tab target="/balance">
+          {i18n.str`Balance`}
+        </Tab>
+        <Tab target="/history">
+          {i18n.str`History`}
+        </Tab>
+        <Tab target="/debug">
+          {i18n.str`Debug`}
+        </Tab>
+      </div>);
+  }
+}
+
+
+function ExtensionLink(props: any) {
+  let onClick = (e: React.MouseEvent<HTMLAnchorElement>) => {
+    chrome.tabs.create({
+                         "url": chrome.extension.getURL(props.target)
+                       });
+    e.preventDefault();
+  };
+  return (
+    <a onClick={onClick} href={props.target}>
+      {props.children}
+    </a>)
+}
+
+
+export function bigAmount(amount: AmountJson): JSX.Element {
+  let v = amount.value + amount.fraction / Amounts.fractionalBase;
+  return (
+    <span>
+      <span style={{fontSize: "300%"}}>{v}</span>
+      {" "}
+      <span>{amount.currency}</span>
+      </span>
+  );
+}
+
+class WalletBalanceView extends React.Component<any, any> {
+  balance: WalletBalance;
+  gotError = false;
+  canceler: (() => void) | undefined = undefined;
+  unmount = false;
+
+  componentWillMount() {
+    this.canceler = onUpdateNotification(() => this.updateBalance());
+    this.updateBalance();
+  }
+
+  componentWillUnmount() {
+    console.log("component WalletBalanceView will unmount");
+    if (this.canceler) {
+      this.canceler();
+    }
+    this.unmount = true;
+  }
+
+  updateBalance() {
+    chrome.runtime.sendMessage({type: "balances"}, (resp) => {
+      if (this.unmount) {
+        return;
+      }
+      if (resp.error) {
+        this.gotError = true;
+        console.error("could not retrieve balances", resp);
+        this.setState({});
+        return;
+      }
+      this.gotError = false;
+      console.log("got wallet", resp);
+      this.balance = resp;
+      this.setState({});
+    });
+  }
+
+  renderEmpty(): JSX.Element {
+    let helpLink = (
+      <ExtensionLink target="/src/pages/help/empty-wallet.html">
+        {i18n.str`help`}
+      </ExtensionLink>
+    );
+    return (
+      <div>
+        <i18n.Translate wrap="p">
+        You have no balance to show. Need some
+          {" "}<span>{helpLink}</span>{" "}
+          getting started?
+        </i18n.Translate>
+      </div>
+    );
+  }
+
+  formatPending(entry: WalletBalanceEntry): JSX.Element {
+    let incoming: JSX.Element | undefined;
+    let payment: JSX.Element | undefined;
+
+    console.log("available: ", entry.pendingIncoming ? amountToPretty(entry.available) : null);
+    console.log("incoming: ", entry.pendingIncoming ? amountToPretty(entry.pendingIncoming) : null);
+
+    if (Amounts.isNonZero(entry.pendingIncoming)) {
+      incoming = (
+        <i18n.Translate wrap="span">
+          <span style={{color: "darkgreen"}}>
+            {"+"}
+            {amountToPretty(entry.pendingIncoming)}
+          </span>
+          {" "}
+          incoming
+      </i18n.Translate>
+      );
+    }
+
+    if (Amounts.isNonZero(entry.pendingPayment)) {
+      payment = (
+        <i18n.Translate wrap="span">
+          <span style={{color: "darkblue"}}>
+            {amountToPretty(entry.pendingPayment)}
+          </span>
+          {" "}
+          being spent
+        </i18n.Translate>
+      );
+    }
+
+    let l = [incoming, payment].filter((x) => x !== undefined);
+    if (l.length == 0) {
+      return <span />;
+    }
+
+    if (l.length == 1) {
+      return <span>({l})</span>
+    }
+    return <span>({l[0]}, {l[1]})</span>;
+
+  }
+
+  render(): JSX.Element {
+    let wallet = this.balance;
+    if (this.gotError) {
+      return i18n.str`Error: could not retrieve balance information.`;
+    }
+    if (!wallet) {
+      return <span></span>;
+    }
+    console.log(wallet);
+    let paybackAvailable = false;
+    let listing = Object.keys(wallet).map((key) => {
+      let entry: WalletBalanceEntry = wallet[key];
+      if (entry.paybackAmount.value != 0 || entry.paybackAmount.fraction != 0) {
+        paybackAvailable = true;
+      }
+      return (
+        <p>
+          {bigAmount(entry.available)}
+          {" "}
+          {this.formatPending(entry)}
+        </p>
+      );
+    });
+    let link = chrome.extension.getURL("/src/pages/auditors.html");
+    let linkElem = <a className="actionLink" href={link} target="_blank">Trusted Auditors and Exchanges</a>;
+    let paybackLink = chrome.extension.getURL("/src/pages/payback.html");
+    let paybackLinkElem = <a className="actionLink" href={link} target="_blank">Trusted Auditors and Exchanges</a>;
+    return (
+      <div>
+        {listing.length > 0 ? listing : this.renderEmpty()}
+        {paybackAvailable && paybackLinkElem}
+        {linkElem}
+      </div>
+    );
+  }
+}
+
+
+function formatHistoryItem(historyItem: HistoryRecord) {
+  const d = historyItem.detail;
+  const t = historyItem.timestamp;
+  console.log("hist item", historyItem);
+  switch (historyItem.type) {
+    case "create-reserve":
+      return (
+        <i18n.Translate wrap="p">
+          Bank requested reserve (<span>{abbrev(d.reservePub)}</span>) for <span>{amountToPretty(d.requestedAmount)}</span>.
+        </i18n.Translate>
+      );
+    case "confirm-reserve": {
+      // FIXME: eventually remove compat fix
+      let exchange = d.exchangeBaseUrl ? (new URI(d.exchangeBaseUrl)).host() : "??";
+      let pub = abbrev(d.reservePub);
+      return (
+        <i18n.Translate wrap="p">
+          Started to withdraw
+          {" "}{amountToPretty(d.requestedAmount)}{" "}
+          from <span>{exchange}</span> (<span>{pub}</span>).
+        </i18n.Translate>
+      );
+    }
+    case "offer-contract": {
+      let link = chrome.extension.getURL("view-contract.html");
+      let linkElem = <a href={link}>{abbrev(d.contractHash)}</a>;
+      let merchantElem = <em>{abbrev(d.merchantName, 15)}</em>;
+      return (
+        <i18n.Translate wrap="p">
+          Merchant <em>{abbrev(d.merchantName, 15)}</em> offered contract <a href={link}>{abbrev(d.contractHash)}</a>;
+        </i18n.Translate>
+      );
+    }
+    case "depleted-reserve": {
+      let exchange = d.exchangeBaseUrl ? (new URI(d.exchangeBaseUrl)).host() : "??";
+      let amount = amountToPretty(d.requestedAmount);
+      let pub = abbrev(d.reservePub);
+      return (
+        <i18n.Translate wrap="p">
+          Withdrew <span>{amount}</span> from <span>{exchange}</span> (<span>{pub}</span>).
+        </i18n.Translate>
+      );
+    }
+    case "pay": {
+      let url = d.fulfillmentUrl;
+      let merchantElem = <em>{abbrev(d.merchantName, 15)}</em>;
+      let fulfillmentLinkElem = <a href={url} onClick={openTab(url)}>view product</a>;
+      return (
+        <i18n.Translate wrap="p">
+          Paid <span>{amountToPretty(d.amount)}</span> to merchant <span>{merchantElem}</span>.  (<span>{fulfillmentLinkElem}</span>)
+        </i18n.Translate>
+      );
+    }
+    default:
+      return (<p>{i18n.str`Unknown event (${historyItem.type})`}</p>);
+  }
+}
+
+
+class WalletHistory extends React.Component<any, any> {
+  myHistory: any[];
+  gotError = false;
+  unmounted = false;
+
+  componentWillMount() {
+    this.update();
+    onUpdateNotification(() => this.update());
+  }
+
+  componentWillUnmount() {
+    console.log("history component unmounted");
+    this.unmounted = true;
+  }
+
+  update() {
+    chrome.runtime.sendMessage({type: "get-history"}, (resp) => {
+      if (this.unmounted) {
+        return;
+      }
+      console.log("got history response");
+      if (resp.error) {
+        this.gotError = true;
+        console.error("could not retrieve history", resp);
+        this.setState({});
+        return;
+      }
+      this.gotError = false;
+      console.log("got history", resp.history);
+      this.myHistory = resp.history;
+      this.setState({});
+    });
+  }
+
+  render(): JSX.Element {
+    console.log("rendering history");
+    let history: HistoryRecord[] = this.myHistory;
+    if (this.gotError) {
+      return i18n.str`Error: could not retrieve event history`;
+    }
+
+    if (!history) {
+      // We're not ready yet
+      return <span />;
+    }
+
+    let subjectMemo: {[s: string]: boolean} = {};
+    let listing: any[] = [];
+    for (let record of history.reverse()) {
+      if (record.subjectId && subjectMemo[record.subjectId]) {
+        continue;
+      }
+      if (record.level != undefined && record.level < HistoryLevel.User) {
+        continue;
+      }
+      subjectMemo[record.subjectId as string] = true;
+
+      let item = (
+        <div className="historyItem">
+          <div className="historyDate">
+            {(new Date(record.timestamp)).toString()}
+          </div>
+          {formatHistoryItem(record)}
+        </div>
+      );
+
+      listing.push(item);
+    }
+
+    if (listing.length > 0) {
+      return <div className="container">{listing}</div>;
+    }
+    return <p>{i18n.str`Your wallet has no events recorded.`}</p>
+  }
+
+}
+
+
+function reload() {
+  try {
+    chrome.runtime.reload();
+    window.close();
+  } catch (e) {
+    // Functionality missing in firefox, ignore!
+  }
+}
+
+function confirmReset() {
+  if (confirm("Do you want to IRREVOCABLY DESTROY everything inside your" +
+              " wallet and LOSE ALL YOUR COINS?")) {
+    chrome.runtime.sendMessage({type: "reset"});
+    window.close();
+  }
+}
+
+
+function WalletDebug(props: any) {
+  return (<div>
+    <p>Debug tools:</p>
+    <button onClick={openExtensionPage("/src/pages/popup.html")}>
+      wallet tab
+    </button>
+    <button onClick={openExtensionPage("/src/pages/show-db.html")}>
+      show db
+    </button>
+    <button onClick={openExtensionPage("/src/pages/tree.html")}>
+      show tree
+    </button>
+    <button onClick={openExtensionPage("/src/pages/logs.html")}>
+      show logs
+    </button>
+    <br />
+    <button onClick={confirmReset}>
+      reset
+    </button>
+    <button onClick={reload}>
+      reload chrome extension
+    </button>
+  </div>);
+}
+
+
+function openExtensionPage(page: string) {
+  return function() {
+    chrome.tabs.create({
+      "url": chrome.extension.getURL(page)
+    });
+  }
+}
+
+
+function openTab(page: string) {
+  return function() {
+    chrome.tabs.create({
+      "url": page
+    });
+  }
+}
+
+
+let el = (
+  <div>
+    <WalletNavBar />
+    <div style={{margin: "1em"}}>
+      <Router>
+        <WalletBalanceView route="/balance" default/>
+        <WalletHistory route="/history"/>
+        <WalletDebug route="/debug"/>
+      </Router>
+    </div>
+  </div>
+);
+
+document.addEventListener("DOMContentLoaded", () => {
+  ReactDOM.render(el, document.getElementById("content")!);
+})
diff --git a/src/webex/pages/show-db.html b/src/webex/pages/show-db.html
new file mode 100644
index 000000000..215c726d9
--- /dev/null
+++ b/src/webex/pages/show-db.html
@@ -0,0 +1,18 @@
+<!doctype html>
+<html>
+  <head>
+    <meta charset="UTF-8">
+    <title>Taler Wallet: Reserve Created</title>
+    <link rel="stylesheet" type="text/css" href="../style/wallet.css">
+    <link rel="icon" href="/img/icon.png">
+    <script src="/dist/page-common.js"></script>
+    <script src="/dist/show-db-bundle.js"></script>
+  </head>
+  <body>
+    <h1>DB Dump</h1>
+    <input type="file" id="fileInput" style="display:none">
+    <button id="import">Import Dump</button>
+    <button id="download">Download Dump</button>
+    <pre id="dump"></pre>
+  </body>
+</html>
diff --git a/src/webex/pages/show-db.ts b/src/webex/pages/show-db.ts
new file mode 100644
index 000000000..d95951385
--- /dev/null
+++ b/src/webex/pages/show-db.ts
@@ -0,0 +1,94 @@
+/*
+ This file is part of TALER
+ (C) 2015 GNUnet e.V.
+
+ TALER is free software; you can redistribute it and/or modify it under the
+ terms of the GNU General Public License as published by the Free Software
+ Foundation; either version 3, or (at your option) any later version.
+
+ TALER is distributed in the hope that it will be useful, but WITHOUT ANY
+ WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR
+ A PARTICULAR PURPOSE.  See the GNU General Public License for more details.
+
+ You should have received a copy of the GNU General Public License along with
+ TALER; see the file COPYING.  If not, see <http://www.gnu.org/licenses/>
+ */
+
+
+/**
+ * Wallet database dump for debugging.
+ *
+ * @author Florian Dold
+ */
+
+function replacer(match: string, pIndent: string, pKey: string, pVal: string,
+                  pEnd: string) {
+  const key = "<span class=json-key>";
+  const val = "<span class=json-value>";
+  const str = "<span class=json-string>";
+  let r = pIndent || "";
+  if (pKey) {
+    r = r + key + '"' + pKey.replace(/[": ]/g, "") + '":</span> ';
+  }
+  if (pVal) {
+    r = r + (pVal[0] === '"' ? str : val) + pVal + "</span>";
+  }
+  return r + (pEnd || "");
+}
+
+
+function prettyPrint(obj: any) {
+  const jsonLine = /^( *)("[\w]+": )?("[^"]*"|[\w.+-]*)?([,[{])?$/mg;
+  return JSON.stringify(obj, null as any, 3)
+             .replace(/&/g, "&amp;").replace(/\\"/g, "&quot;")
+             .replace(/</g, "&lt;").replace(/>/g, "&gt;")
+             .replace(jsonLine, replacer);
+}
+
+
+document.addEventListener("DOMContentLoaded", () => {
+  chrome.runtime.sendMessage({type: "dump-db"}, (resp) => {
+    const el = document.getElementById("dump");
+    if (!el) {
+      throw Error();
+    }
+    el.innerHTML = prettyPrint(resp);
+
+    document.getElementById("download")!.addEventListener("click", (evt) => {
+      console.log("creating download");
+      const element = document.createElement("a");
+      element.setAttribute("href", "data:text/plain;charset=utf-8," + encodeURIComponent(JSON.stringify(resp)));
+      element.setAttribute("download", "wallet-dump.txt");
+      element.style.display = "none";
+      document.body.appendChild(element);
+      element.click();
+    });
+
+  });
+
+
+  const fileInput = document.getElementById("fileInput")! as HTMLInputElement;
+  fileInput.onchange = (evt) => {
+    if (!fileInput.files || fileInput.files.length !== 1) {
+      alert("please select exactly one file to import");
+      return;
+    }
+    const file = fileInput.files[0];
+    const fr = new FileReader();
+    fr.onload = (e: any) => {
+      console.log("got file");
+      const dump = JSON.parse(e.target.result);
+      console.log("parsed contents", dump);
+      chrome.runtime.sendMessage({ type: "import-db", detail: { dump } }, (resp) => {
+        alert("loaded");
+      });
+    };
+    console.log("reading file", file);
+    fr.readAsText(file);
+  };
+
+  document.getElementById("import")!.addEventListener("click", (evt) => {
+    fileInput.click();
+    evt.preventDefault();
+  });
+});
diff --git a/src/webex/pages/tree.html b/src/webex/pages/tree.html
new file mode 100644
index 000000000..0c0a368b3
--- /dev/null
+++ b/src/webex/pages/tree.html
@@ -0,0 +1,27 @@
+<!DOCTYPE html>
+<html>
+
+<head>
+  <meta charset="UTF-8">
+  <title>Taler Wallet: Tree View</title>
+
+  <link rel="stylesheet" type="text/css" href="../style/wallet.css">
+
+  <link rel="icon" href="/img/icon.png">
+
+  <script src="/dist/page-common-bundle.js"></script>
+  <script src="/dist/tree-bundle.js"></script>
+
+  <style>
+          .tree-item {
+                  margin: 2em;
+                  border-radius: 5px;
+                  border: 1px solid gray;
+                  padding: 1em;
+          }
+  </style>
+
+  <body>
+    <div id="container"></div>
+  </body>
+</html>
diff --git a/src/webex/pages/tree.tsx b/src/webex/pages/tree.tsx
new file mode 100644
index 000000000..ddf8f2dbc
--- /dev/null
+++ b/src/webex/pages/tree.tsx
@@ -0,0 +1,437 @@
+/*
+ This file is part of TALER
+ (C) 2016 Inria
+
+ TALER is free software; you can redistribute it and/or modify it under the
+ terms of the GNU General Public License as published by the Free Software
+ Foundation; either version 3, or (at your option) any later version.
+
+ TALER is distributed in the hope that it will be useful, but WITHOUT ANY
+ WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR
+ A PARTICULAR PURPOSE.  See the GNU General Public License for more details.
+
+ You should have received a copy of the GNU General Public License along with
+ TALER; see the file COPYING.  If not, see <http://www.gnu.org/licenses/>
+ */
+
+/**
+ * Show contents of the wallet as a tree.
+ *
+ * @author Florian Dold
+ */
+
+
+import { amountToPretty, getTalerStampDate } from "../../helpers";
+import {
+  CoinRecord,
+  CoinStatus,
+  Denomination,
+  DenominationRecord,
+  ExchangeRecord,
+  PreCoinRecord,
+  ReserveRecord,
+} from "../../types";
+
+import { ImplicitStateComponent, StateHolder } from "../components";
+import {
+  getReserves, getExchanges, getCoins, getPreCoins,
+  refresh, getDenoms, payback,
+} from "../wxApi";
+import * as React from "react";
+import * as ReactDOM from "react-dom";
+
+interface ReserveViewProps {
+  reserve: ReserveRecord;
+}
+
+class ReserveView extends React.Component<ReserveViewProps, void> {
+  render(): JSX.Element {
+    let r: ReserveRecord = this.props.reserve;
+    return (
+      <div className="tree-item">
+        <ul>
+          <li>Key: {r.reserve_pub}</li>
+          <li>Created: {(new Date(r.created * 1000).toString())}</li>
+          <li>Current: {r.current_amount ? amountToPretty(r.current_amount!) : "null"}</li>
+          <li>Requested: {amountToPretty(r.requested_amount)}</li>
+          <li>Confirmed: {r.confirmed}</li>
+        </ul>
+      </div>
+    );
+  }
+}
+
+interface ReserveListProps {
+  exchangeBaseUrl: string;
+}
+
+interface ToggleProps {
+  expanded: StateHolder<boolean>;
+}
+
+class Toggle extends ImplicitStateComponent<ToggleProps> {
+  renderButton() {
+    let show = () => {
+      this.props.expanded(true);
+      this.setState({});
+    };
+    let hide = () => {
+      this.props.expanded(false);
+      this.setState({});
+    };
+    if (this.props.expanded()) {
+      return <button onClick={hide}>hide</button>;
+    }
+    return <button onClick={show}>show</button>;
+
+  }
+  render() {
+    return (
+      <div style={{display: "inline"}}>
+        {this.renderButton()}
+        {this.props.expanded() ? this.props.children : []}
+      </div>);
+  }
+}
+
+
+interface CoinViewProps {
+  coin: CoinRecord;
+}
+
+interface RefreshDialogProps {
+  coin: CoinRecord;
+}
+
+class RefreshDialog extends ImplicitStateComponent<RefreshDialogProps> {
+  refreshRequested = this.makeState<boolean>(false);
+  render(): JSX.Element {
+    if (!this.refreshRequested()) {
+      return (
+        <div style={{display: "inline"}}>
+          <button onClick={() => this.refreshRequested(true)}>refresh</button>
+        </div>
+      );
+    }
+    return (
+      <div>
+        Refresh amount: <input type="text" size={10} />
+        <button onClick={() => refresh(this.props.coin.coinPub)}>ok</button>
+        <button onClick={() => this.refreshRequested(false)}>cancel</button>
+      </div>
+      );
+  }
+}
+
+class CoinView extends React.Component<CoinViewProps, void> {
+  render() {
+    let c = this.props.coin;
+    return (
+      <div className="tree-item">
+        <ul>
+          <li>Key: {c.coinPub}</li>
+          <li>Current amount: {amountToPretty(c.currentAmount)}</li>
+          <li>Denomination: <ExpanderText text={c.denomPub} /></li>
+          <li>Suspended: {(c.suspended || false).toString()}</li>
+          <li>Status: {CoinStatus[c.status]}</li>
+          <li><RefreshDialog coin={c} /></li>
+          <li><button onClick={() => payback(c.coinPub)}>Payback</button></li>
+        </ul>
+      </div>
+    );
+  }
+}
+
+
+
+interface PreCoinViewProps {
+  precoin: PreCoinRecord;
+}
+
+class PreCoinView extends React.Component<PreCoinViewProps, void> {
+  render() {
+    let c = this.props.precoin;
+    return (
+      <div className="tree-item">
+        <ul>
+          <li>Key: {c.coinPub}</li>
+        </ul>
+      </div>
+    );
+  }
+}
+
+interface CoinListProps {
+  exchangeBaseUrl: string;
+}
+
+class CoinList extends ImplicitStateComponent<CoinListProps> {
+  coins = this.makeState<CoinRecord[] | null>(null);
+  expanded = this.makeState<boolean>(false);
+
+  constructor(props: CoinListProps) {
+    super(props);
+    this.update(props);
+  }
+
+  async update(props: CoinListProps) {
+    let coins = await getCoins(props.exchangeBaseUrl);
+    this.coins(coins);
+  }
+
+  componentWillReceiveProps(newProps: CoinListProps) {
+    this.update(newProps);
+  }
+
+  render(): JSX.Element {
+    if (!this.coins()) {
+      return <div>...</div>;
+    }
+    return (
+      <div className="tree-item">
+        Coins ({this.coins() !.length.toString()})
+        {" "}
+        <Toggle expanded={this.expanded}>
+          {this.coins() !.map((c) => <CoinView coin={c} />)}
+        </Toggle>
+      </div>
+    );
+  }
+}
+
+
+interface PreCoinListProps {
+  exchangeBaseUrl: string;
+}
+
+class PreCoinList extends ImplicitStateComponent<PreCoinListProps> {
+  precoins = this.makeState<PreCoinRecord[] | null>(null);
+  expanded = this.makeState<boolean>(false);
+
+  constructor(props: PreCoinListProps) {
+    super(props);
+    this.update();
+  }
+
+  async update() {
+    let precoins = await getPreCoins(this.props.exchangeBaseUrl);
+    this.precoins(precoins);
+  }
+
+  render(): JSX.Element {
+    if (!this.precoins()) {
+      return <div>...</div>;
+    }
+    return (
+      <div className="tree-item">
+        Planchets ({this.precoins() !.length.toString()})
+        {" "}
+        <Toggle expanded={this.expanded}>
+          {this.precoins() !.map((c) => <PreCoinView precoin={c} />)}
+        </Toggle>
+      </div>
+    );
+  }
+}
+
+interface DenominationListProps {
+  exchange: ExchangeRecord;
+}
+
+interface ExpanderTextProps {
+  text: string;
+}
+
+class ExpanderText extends ImplicitStateComponent<ExpanderTextProps> {
+  expanded = this.makeState<boolean>(false);
+  textArea: any = undefined;
+
+  componentDidUpdate() {
+    if (this.expanded() && this.textArea) {
+      this.textArea.focus();
+      this.textArea.scrollTop = 0;
+    }
+  }
+
+  render(): JSX.Element {
+    if (!this.expanded()) {
+      return (
+        <span onClick={() => { this.expanded(true); }}>
+          {(this.props.text.length <= 10)
+            ?  this.props.text 
+            : (
+                <span>
+                  {this.props.text.substring(0,10)}
+                  <span style={{textDecoration: "underline"}}>...</span>
+                </span>
+              )
+          }
+        </span>
+      );
+    }
+    return (
+      <textarea
+        readOnly
+        style={{display: "block"}}
+        onBlur={() => this.expanded(false)}
+        ref={(e) => this.textArea = e}>
+        {this.props.text}
+      </textarea>
+    );
+  }
+}
+
+class DenominationList extends ImplicitStateComponent<DenominationListProps> {
+  expanded = this.makeState<boolean>(false);
+  denoms = this.makeState<undefined|DenominationRecord[]>(undefined);
+
+  constructor(props: DenominationListProps) {
+    super(props);
+    this.update();
+  }
+
+  async update() {
+    let d = await getDenoms(this.props.exchange.baseUrl);
+    this.denoms(d);
+  }
+
+  renderDenom(d: DenominationRecord) {
+    return (
+      <div className="tree-item">
+        <ul>
+          <li>Offered: {d.isOffered ? "yes" : "no"}</li>
+          <li>Value: {amountToPretty(d.value)}</li>
+          <li>Withdraw fee: {amountToPretty(d.feeWithdraw)}</li>
+          <li>Refresh fee: {amountToPretty(d.feeRefresh)}</li>
+          <li>Deposit fee: {amountToPretty(d.feeDeposit)}</li>
+          <li>Refund fee: {amountToPretty(d.feeRefund)}</li>
+          <li>Start: {getTalerStampDate(d.stampStart)!.toString()}</li>
+          <li>Withdraw expiration: {getTalerStampDate(d.stampExpireWithdraw)!.toString()}</li>
+          <li>Legal expiration: {getTalerStampDate(d.stampExpireLegal)!.toString()}</li>
+          <li>Deposit expiration: {getTalerStampDate(d.stampExpireDeposit)!.toString()}</li>
+          <li>Denom pub: <ExpanderText text={d.denomPub} /></li>
+        </ul>
+      </div>
+    );
+  }
+
+  render(): JSX.Element {
+    let denoms = this.denoms()
+    if (!denoms) {
+      return (
+        <div className="tree-item">
+        Denominations (...)
+        {" "}
+        <Toggle expanded={this.expanded}>
+          ...
+        </Toggle>
+      </div>
+      );
+    }
+    return (
+      <div className="tree-item">
+        Denominations ({denoms.length.toString()})
+        {" "}
+        <Toggle expanded={this.expanded}>
+          {denoms.map((d) => this.renderDenom(d))}
+        </Toggle>
+      </div>
+    );
+  }
+}
+
+class ReserveList extends ImplicitStateComponent<ReserveListProps> {
+  reserves = this.makeState<ReserveRecord[] | null>(null);
+  expanded = this.makeState<boolean>(false);
+
+  constructor(props: ReserveListProps) {
+    super(props);
+    this.update();
+  }
+
+  async update() {
+    let reserves = await getReserves(this.props.exchangeBaseUrl);
+    this.reserves(reserves);
+  }
+
+  render(): JSX.Element {
+    if (!this.reserves()) {
+      return <div>...</div>;
+    }
+    return (
+      <div className="tree-item">
+        Reserves ({this.reserves() !.length.toString()})
+        {" "}
+        <Toggle expanded={this.expanded}>
+          {this.reserves() !.map((r) => <ReserveView reserve={r} />)}
+        </Toggle>
+      </div>
+    );
+  }
+}
+
+interface ExchangeProps {
+  exchange: ExchangeRecord;
+}
+
+class ExchangeView extends React.Component<ExchangeProps, void> {
+  render(): JSX.Element {
+    let e = this.props.exchange;
+    return (
+      <div className="tree-item">
+        <ul>
+          <li>Exchange Base Url: {this.props.exchange.baseUrl}</li>
+          <li>Master public key: <ExpanderText text={this.props.exchange.masterPublicKey} /></li>
+        </ul>
+        <DenominationList exchange={e} />
+        <ReserveList exchangeBaseUrl={this.props.exchange.baseUrl} />
+        <CoinList exchangeBaseUrl={this.props.exchange.baseUrl} />
+        <PreCoinList exchangeBaseUrl={this.props.exchange.baseUrl} />
+      </div>
+    );
+  }
+}
+
+interface ExchangesListState {
+  exchanges?: ExchangeRecord[];
+}
+
+class ExchangesList extends React.Component<any, ExchangesListState> {
+  constructor() {
+    super();
+    let port = chrome.runtime.connect();
+    port.onMessage.addListener((msg: any) => {
+      if (msg.notify) {
+        console.log("got notified");
+        this.update();
+      }
+    });
+    this.update();
+    this.state = {} as any;
+  }
+
+  async update() {
+    let exchanges = await getExchanges();
+    console.log("exchanges: ", exchanges);
+    this.setState({ exchanges });
+  }
+
+  render(): JSX.Element {
+    let exchanges = this.state.exchanges;
+    if (!exchanges) {
+      return <span>...</span>;
+    }
+    return (
+      <div className="tree-item">
+        Exchanges ({exchanges.length.toString()}):
+        {exchanges.map(e => <ExchangeView exchange={e} />)}
+      </div>
+    );
+  }
+}
+
+export function main() {
+  ReactDOM.render(<ExchangesList />, document.getElementById("container")!);
+}
+
+document.addEventListener("DOMContentLoaded", main);
diff --git a/src/webex/renderHtml.tsx b/src/webex/renderHtml.tsx
new file mode 100644
index 000000000..440cd5789
--- /dev/null
+++ b/src/webex/renderHtml.tsx
@@ -0,0 +1,79 @@
+/*
+ This file is part of TALER
+ (C) 2016 INRIA
+
+ TALER is free software; you can redistribute it and/or modify it under the
+ terms of the GNU General Public License as published by the Free Software
+ Foundation; either version 3, or (at your option) any later version.
+
+ TALER is distributed in the hope that it will be useful, but WITHOUT ANY
+ WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR
+ A PARTICULAR PURPOSE.  See the GNU General Public License for more details.
+
+ You should have received a copy of the GNU General Public License along with
+ TALER; see the file COPYING.  If not, see <http://www.gnu.org/licenses/>
+ */
+
+/**
+ * Helpers functions to render Taler-related data structures to HTML.
+ *
+ * @author Florian Dold
+ */
+
+
+/**
+ * Imports.
+ */
+import {
+  AmountJson,
+  Amounts,
+  Contract,
+} from "../types";
+import * as i18n from "../i18n";
+import { amountToPretty } from "../helpers";
+
+import * as React from "react";
+
+
+export function renderContract(contract: Contract): JSX.Element {
+  let merchantName;
+  if (contract.merchant && contract.merchant.name) {
+    merchantName = <strong>{contract.merchant.name}</strong>;
+  } else {
+    merchantName = <strong>(pub: {contract.merchant_pub})</strong>;
+  }
+  let amount = <strong>{amountToPretty(contract.amount)}</strong>;
+
+  return (
+    <div>
+      <i18n.Translate wrap="p">
+        The merchant <span>{merchantName}</span>
+        wants to enter a contract over <span>{amount}</span>{" "}
+        with you.
+      </i18n.Translate>
+      <p>{i18n.str`You are about to purchase:`}</p>
+      <ul>
+        {contract.products.map(
+          (p: any, i: number) => (<li key={i}>{`${p.description}: ${amountToPretty(p.price)}`}</li>))
+        }
+      </ul>
+    </div>
+  );
+}
+
+
+/**
+ * Abbreviate a string to a given length, and show the full
+ * string on hover as a tooltip.
+ */
+export function abbrev(s: string, n: number = 5) {
+  let sAbbrev = s;
+  if (s.length > n) {
+    sAbbrev = s.slice(0, n) + "..";
+  }
+  return (
+    <span className="abbrev" title={s}>
+      {sAbbrev}
+    </span>
+  );
+}
diff --git a/src/webex/style/pure.css b/src/webex/style/pure.css
new file mode 100644
index 000000000..739113970
--- /dev/null
+++ b/src/webex/style/pure.css
@@ -0,0 +1,1508 @@
+/*!
+Pure v0.6.2
+Copyright 2013 Yahoo!
+Licensed under the BSD License.
+https://github.com/yahoo/pure/blob/master/LICENSE.md
+*/
+/*!
+normalize.css v^3.0 | MIT License | git.io/normalize
+Copyright (c) Nicolas Gallagher and Jonathan Neal
+*/
+/*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */
+
+/**
+ * 1. Set default font family to sans-serif.
+ * 2. Prevent iOS and IE text size adjust after device orientation change,
+ *    without disabling user zoom.
+ */
+
+html {
+  font-family: sans-serif; /* 1 */
+  -ms-text-size-adjust: 100%; /* 2 */
+  -webkit-text-size-adjust: 100%; /* 2 */
+}
+
+/**
+ * Remove default margin.
+ */
+
+body {
+  margin: 0;
+}
+
+/* HTML5 display definitions
+   ========================================================================== */
+
+/**
+ * Correct `block` display not defined for any HTML5 element in IE 8/9.
+ * Correct `block` display not defined for `details` or `summary` in IE 10/11
+ * and Firefox.
+ * Correct `block` display not defined for `main` in IE 11.
+ */
+
+article,
+aside,
+details,
+figcaption,
+figure,
+footer,
+header,
+hgroup,
+main,
+menu,
+nav,
+section,
+summary {
+  display: block;
+}
+
+/**
+ * 1. Correct `inline-block` display not defined in IE 8/9.
+ * 2. Normalize vertical alignment of `progress` in Chrome, Firefox, and Opera.
+ */
+
+audio,
+canvas,
+progress,
+video {
+  display: inline-block; /* 1 */
+  vertical-align: baseline; /* 2 */
+}
+
+/**
+ * Prevent modern browsers from displaying `audio` without controls.
+ * Remove excess height in iOS 5 devices.
+ */
+
+audio:not([controls]) {
+  display: none;
+  height: 0;
+}
+
+/**
+ * Address `[hidden]` styling not present in IE 8/9/10.
+ * Hide the `template` element in IE 8/9/10/11, Safari, and Firefox < 22.
+ */
+
+[hidden],
+template {
+  display: none;
+}
+
+/* Links
+   ========================================================================== */
+
+/**
+ * Remove the gray background color from active links in IE 10.
+ */
+
+a {
+  background-color: transparent;
+}
+
+/**
+ * Improve readability of focused elements when they are also in an
+ * active/hover state.
+ */
+
+a:active,
+a:hover {
+  outline: 0;
+}
+
+/* Text-level semantics
+   ========================================================================== */
+
+/**
+ * Address styling not present in IE 8/9/10/11, Safari, and Chrome.
+ */
+
+abbr[title] {
+  border-bottom: 1px dotted;
+}
+
+/**
+ * Address style set to `bolder` in Firefox 4+, Safari, and Chrome.
+ */
+
+b,
+strong {
+  font-weight: bold;
+}
+
+/**
+ * Address styling not present in Safari and Chrome.
+ */
+
+dfn {
+  font-style: italic;
+}
+
+/**
+ * Address variable `h1` font-size and margin within `section` and `article`
+ * contexts in Firefox 4+, Safari, and Chrome.
+ */
+
+h1 {
+  font-size: 2em;
+  margin: 0.67em 0;
+}
+
+/**
+ * Address styling not present in IE 8/9.
+ */
+
+mark {
+  background: #ff0;
+  color: #000;
+}
+
+/**
+ * Address inconsistent and variable font size in all browsers.
+ */
+
+small {
+  font-size: 80%;
+}
+
+/**
+ * Prevent `sub` and `sup` affecting `line-height` in all browsers.
+ */
+
+sub,
+sup {
+  font-size: 75%;
+  line-height: 0;
+  position: relative;
+  vertical-align: baseline;
+}
+
+sup {
+  top: -0.5em;
+}
+
+sub {
+  bottom: -0.25em;
+}
+
+/* Embedded content
+   ========================================================================== */
+
+/**
+ * Remove border when inside `a` element in IE 8/9/10.
+ */
+
+img {
+  border: 0;
+}
+
+/**
+ * Correct overflow not hidden in IE 9/10/11.
+ */
+
+svg:not(:root) {
+  overflow: hidden;
+}
+
+/* Grouping content
+   ========================================================================== */
+
+/**
+ * Address margin not present in IE 8/9 and Safari.
+ */
+
+figure {
+  margin: 1em 40px;
+}
+
+/**
+ * Address differences between Firefox and other browsers.
+ */
+
+hr {
+  box-sizing: content-box;
+  height: 0;
+}
+
+/**
+ * Contain overflow in all browsers.
+ */
+
+pre {
+  overflow: auto;
+}
+
+/**
+ * Address odd `em`-unit font size rendering in all browsers.
+ */
+
+code,
+kbd,
+pre,
+samp {
+  font-family: monospace, monospace;
+  font-size: 1em;
+}
+
+/* Forms
+   ========================================================================== */
+
+/**
+ * Known limitation: by default, Chrome and Safari on OS X allow very limited
+ * styling of `select`, unless a `border` property is set.
+ */
+
+/**
+ * 1. Correct color not being inherited.
+ *    Known issue: affects color of disabled elements.
+ * 2. Correct font properties not being inherited.
+ * 3. Address margins set differently in Firefox 4+, Safari, and Chrome.
+ */
+
+button,
+input,
+optgroup,
+select,
+textarea {
+  color: inherit; /* 1 */
+  font: inherit; /* 2 */
+  margin: 0; /* 3 */
+}
+
+/**
+ * Address `overflow` set to `hidden` in IE 8/9/10/11.
+ */
+
+button {
+  overflow: visible;
+}
+
+/**
+ * Address inconsistent `text-transform` inheritance for `button` and `select`.
+ * All other form control elements do not inherit `text-transform` values.
+ * Correct `button` style inheritance in Firefox, IE 8/9/10/11, and Opera.
+ * Correct `select` style inheritance in Firefox.
+ */
+
+button,
+select {
+  text-transform: none;
+}
+
+/**
+ * 1. Avoid the WebKit bug in Android 4.0.* where (2) destroys native `audio`
+ *    and `video` controls.
+ * 2. Correct inability to style clickable `input` types in iOS.
+ * 3. Improve usability and consistency of cursor style between image-type
+ *    `input` and others.
+ */
+
+button,
+html input[type="button"], /* 1 */
+input[type="reset"],
+input[type="submit"] {
+  -webkit-appearance: button; /* 2 */
+  cursor: pointer; /* 3 */
+}
+
+/**
+ * Re-set default cursor for disabled elements.
+ */
+
+button[disabled],
+html input[disabled] {
+  cursor: default;
+}
+
+/**
+ * Remove inner padding and border in Firefox 4+.
+ */
+
+button::-moz-focus-inner,
+input::-moz-focus-inner {
+  border: 0;
+  padding: 0;
+}
+
+/**
+ * Address Firefox 4+ setting `line-height` on `input` using `!important` in
+ * the UA stylesheet.
+ */
+
+input {
+  line-height: normal;
+}
+
+/**
+ * It's recommended that you don't attempt to style these elements.
+ * Firefox's implementation doesn't respect box-sizing, padding, or width.
+ *
+ * 1. Address box sizing set to `content-box` in IE 8/9/10.
+ * 2. Remove excess padding in IE 8/9/10.
+ */
+
+input[type="checkbox"],
+input[type="radio"] {
+  box-sizing: border-box; /* 1 */
+  padding: 0; /* 2 */
+}
+
+/**
+ * Fix the cursor style for Chrome's increment/decrement buttons. For certain
+ * `font-size` values of the `input`, it causes the cursor style of the
+ * decrement button to change from `default` to `text`.
+ */
+
+input[type="number"]::-webkit-inner-spin-button,
+input[type="number"]::-webkit-outer-spin-button {
+  height: auto;
+}
+
+/**
+ * 1. Address `appearance` set to `searchfield` in Safari and Chrome.
+ * 2. Address `box-sizing` set to `border-box` in Safari and Chrome.
+ */
+
+input[type="search"] {
+  -webkit-appearance: textfield; /* 1 */
+  box-sizing: content-box; /* 2 */
+}
+
+/**
+ * Remove inner padding and search cancel button in Safari and Chrome on OS X.
+ * Safari (but not Chrome) clips the cancel button when the search input has
+ * padding (and `textfield` appearance).
+ */
+
+input[type="search"]::-webkit-search-cancel-button,
+input[type="search"]::-webkit-search-decoration {
+  -webkit-appearance: none;
+}
+
+/**
+ * Define consistent border, margin, and padding.
+ */
+
+fieldset {
+  border: 1px solid #c0c0c0;
+  margin: 0 2px;
+  padding: 0.35em 0.625em 0.75em;
+}
+
+/**
+ * 1. Correct `color` not being inherited in IE 8/9/10/11.
+ * 2. Remove padding so people aren't caught out if they zero out fieldsets.
+ */
+
+legend {
+  border: 0; /* 1 */
+  padding: 0; /* 2 */
+}
+
+/**
+ * Remove default vertical scrollbar in IE 8/9/10/11.
+ */
+
+textarea {
+  overflow: auto;
+}
+
+/**
+ * Don't inherit the `font-weight` (applied by a rule above).
+ * NOTE: the default cannot safely be changed in Chrome and Safari on OS X.
+ */
+
+optgroup {
+  font-weight: bold;
+}
+
+/* Tables
+   ========================================================================== */
+
+/**
+ * Remove most spacing between table cells.
+ */
+
+table {
+  border-collapse: collapse;
+  border-spacing: 0;
+}
+
+td,
+th {
+  padding: 0;
+}
+
+/*csslint important:false*/
+
+/* ==========================================================================
+   Pure Base Extras
+   ========================================================================== */
+
+/**
+ * Extra rules that Pure adds on top of Normalize.css
+ */
+
+/**
+ * Always hide an element when it has the `hidden` HTML attribute.
+ */
+
+.hidden,
+[hidden] {
+    display: none !important;
+}
+
+/**
+ * Add this class to an image to make it fit within it's fluid parent wrapper while maintaining
+ * aspect ratio.
+ */
+.pure-img {
+    max-width: 100%;
+    height: auto;
+    display: block;
+}
+
+/*csslint regex-selectors:false, known-properties:false, duplicate-properties:false*/
+
+.pure-g {
+    letter-spacing: -0.31em; /* Webkit: collapse white-space between units */
+    *letter-spacing: normal; /* reset IE < 8 */
+    *word-spacing: -0.43em; /* IE < 8: collapse white-space between units */
+    text-rendering: optimizespeed; /* Webkit: fixes text-rendering: optimizeLegibility */
+
+    /*
+    Sets the font stack to fonts known to work properly with the above letter
+    and word spacings. See: https://github.com/yahoo/pure/issues/41/
+
+    The following font stack makes Pure Grids work on all known environments.
+
+    * FreeSans: Ships with many Linux distros, including Ubuntu
+
+    * Arimo: Ships with Chrome OS. Arimo has to be defined before Helvetica and
+      Arial to get picked up by the browser, even though neither is available
+      in Chrome OS.
+
+    * Droid Sans: Ships with all versions of Android.
+
+    * Helvetica, Arial, sans-serif: Common font stack on OS X and Windows.
+    */
+    font-family: FreeSans, Arimo, "Droid Sans", Helvetica, Arial, sans-serif;
+
+    /* Use flexbox when possible to avoid `letter-spacing` side-effects. */
+    display: -webkit-box;
+    display: -webkit-flex;
+    display: -ms-flexbox;
+    display: flex;
+    -webkit-flex-flow: row wrap;
+        -ms-flex-flow: row wrap;
+            flex-flow: row wrap;
+
+    /* Prevents distributing space between rows */
+    -webkit-align-content: flex-start;
+        -ms-flex-line-pack: start;
+            align-content: flex-start;
+}
+
+/* IE10 display: -ms-flexbox (and display: flex in IE 11) does not work inside a table; fall back to block and rely on font hack */
+@media all and (-ms-high-contrast: none), (-ms-high-contrast: active) {
+	table .pure-g {
+		display: block;
+	}
+}
+
+/* Opera as of 12 on Windows needs word-spacing.
+   The ".opera-only" selector is used to prevent actual prefocus styling
+   and is not required in markup.
+*/
+.opera-only :-o-prefocus,
+.pure-g {
+    word-spacing: -0.43em;
+}
+
+.pure-u {
+    display: inline-block;
+    *display: inline; /* IE < 8: fake inline-block */
+    zoom: 1;
+    letter-spacing: normal;
+    word-spacing: normal;
+    vertical-align: top;
+    text-rendering: auto;
+}
+
+/*
+Resets the font family back to the OS/browser's default sans-serif font,
+this the same font stack that Normalize.css sets for the `body`.
+*/
+.pure-g [class *= "pure-u"] {
+    font-family: sans-serif;
+}
+
+.pure-u-1,
+.pure-u-1-1,
+.pure-u-1-2,
+.pure-u-1-3,
+.pure-u-2-3,
+.pure-u-1-4,
+.pure-u-3-4,
+.pure-u-1-5,
+.pure-u-2-5,
+.pure-u-3-5,
+.pure-u-4-5,
+.pure-u-5-5,
+.pure-u-1-6,
+.pure-u-5-6,
+.pure-u-1-8,
+.pure-u-3-8,
+.pure-u-5-8,
+.pure-u-7-8,
+.pure-u-1-12,
+.pure-u-5-12,
+.pure-u-7-12,
+.pure-u-11-12,
+.pure-u-1-24,
+.pure-u-2-24,
+.pure-u-3-24,
+.pure-u-4-24,
+.pure-u-5-24,
+.pure-u-6-24,
+.pure-u-7-24,
+.pure-u-8-24,
+.pure-u-9-24,
+.pure-u-10-24,
+.pure-u-11-24,
+.pure-u-12-24,
+.pure-u-13-24,
+.pure-u-14-24,
+.pure-u-15-24,
+.pure-u-16-24,
+.pure-u-17-24,
+.pure-u-18-24,
+.pure-u-19-24,
+.pure-u-20-24,
+.pure-u-21-24,
+.pure-u-22-24,
+.pure-u-23-24,
+.pure-u-24-24 {
+    display: inline-block;
+    *display: inline;
+    zoom: 1;
+    letter-spacing: normal;
+    word-spacing: normal;
+    vertical-align: top;
+    text-rendering: auto;
+}
+
+.pure-u-1-24 {
+    width: 4.1667%;
+    *width: 4.1357%;
+}
+
+.pure-u-1-12,
+.pure-u-2-24 {
+    width: 8.3333%;
+    *width: 8.3023%;
+}
+
+.pure-u-1-8,
+.pure-u-3-24 {
+    width: 12.5000%;
+    *width: 12.4690%;
+}
+
+.pure-u-1-6,
+.pure-u-4-24 {
+    width: 16.6667%;
+    *width: 16.6357%;
+}
+
+.pure-u-1-5 {
+    width: 20%;
+    *width: 19.9690%;
+}
+
+.pure-u-5-24 {
+    width: 20.8333%;
+    *width: 20.8023%;
+}
+
+.pure-u-1-4,
+.pure-u-6-24 {
+    width: 25%;
+    *width: 24.9690%;
+}
+
+.pure-u-7-24 {
+    width: 29.1667%;
+    *width: 29.1357%;
+}
+
+.pure-u-1-3,
+.pure-u-8-24 {
+    width: 33.3333%;
+    *width: 33.3023%;
+}
+
+.pure-u-3-8,
+.pure-u-9-24 {
+    width: 37.5000%;
+    *width: 37.4690%;
+}
+
+.pure-u-2-5 {
+    width: 40%;
+    *width: 39.9690%;
+}
+
+.pure-u-5-12,
+.pure-u-10-24 {
+    width: 41.6667%;
+    *width: 41.6357%;
+}
+
+.pure-u-11-24 {
+    width: 45.8333%;
+    *width: 45.8023%;
+}
+
+.pure-u-1-2,
+.pure-u-12-24 {
+    width: 50%;
+    *width: 49.9690%;
+}
+
+.pure-u-13-24 {
+    width: 54.1667%;
+    *width: 54.1357%;
+}
+
+.pure-u-7-12,
+.pure-u-14-24 {
+    width: 58.3333%;
+    *width: 58.3023%;
+}
+
+.pure-u-3-5 {
+    width: 60%;
+    *width: 59.9690%;
+}
+
+.pure-u-5-8,
+.pure-u-15-24 {
+    width: 62.5000%;
+    *width: 62.4690%;
+}
+
+.pure-u-2-3,
+.pure-u-16-24 {
+    width: 66.6667%;
+    *width: 66.6357%;
+}
+
+.pure-u-17-24 {
+    width: 70.8333%;
+    *width: 70.8023%;
+}
+
+.pure-u-3-4,
+.pure-u-18-24 {
+    width: 75%;
+    *width: 74.9690%;
+}
+
+.pure-u-19-24 {
+    width: 79.1667%;
+    *width: 79.1357%;
+}
+
+.pure-u-4-5 {
+    width: 80%;
+    *width: 79.9690%;
+}
+
+.pure-u-5-6,
+.pure-u-20-24 {
+    width: 83.3333%;
+    *width: 83.3023%;
+}
+
+.pure-u-7-8,
+.pure-u-21-24 {
+    width: 87.5000%;
+    *width: 87.4690%;
+}
+
+.pure-u-11-12,
+.pure-u-22-24 {
+    width: 91.6667%;
+    *width: 91.6357%;
+}
+
+.pure-u-23-24 {
+    width: 95.8333%;
+    *width: 95.8023%;
+}
+
+.pure-u-1,
+.pure-u-1-1,
+.pure-u-5-5,
+.pure-u-24-24 {
+    width: 100%;
+}
+.pure-button {
+    /* Structure */
+    display: inline-block;
+    zoom: 1;
+    line-height: normal;
+    white-space: nowrap;
+    vertical-align: middle;
+    text-align: center;
+    cursor: pointer;
+    -webkit-user-drag: none;
+    -webkit-user-select: none;
+       -moz-user-select: none;
+        -ms-user-select: none;
+            user-select: none;
+    box-sizing: border-box;
+}
+
+/* Firefox: Get rid of the inner focus border */
+.pure-button::-moz-focus-inner {
+    padding: 0;
+    border: 0;
+}
+
+/* Inherit .pure-g styles */
+.pure-button-group {
+    letter-spacing: -0.31em; /* Webkit: collapse white-space between units */
+    *letter-spacing: normal; /* reset IE < 8 */
+    *word-spacing: -0.43em; /* IE < 8: collapse white-space between units */
+    text-rendering: optimizespeed; /* Webkit: fixes text-rendering: optimizeLegibility */
+}
+
+.opera-only :-o-prefocus,
+.pure-button-group {
+    word-spacing: -0.43em;
+}
+
+.pure-button-group .pure-button {
+    letter-spacing: normal;
+    word-spacing: normal;
+    vertical-align: top;
+    text-rendering: auto;
+}
+
+/*csslint outline-none:false*/
+
+.pure-button {
+    font-family: inherit;
+    font-size: 100%;
+    padding: 0.5em 1em;
+    color: #444; /* rgba not supported (IE 8) */
+    color: rgba(0, 0, 0, 0.80); /* rgba supported */
+    border: 1px solid #999;  /*IE 6/7/8*/
+    border: none rgba(0, 0, 0, 0);  /*IE9 + everything else*/
+    background-color: #E6E6E6;
+    text-decoration: none;
+    border-radius: 2px;
+}
+
+.pure-button-hover,
+.pure-button:hover,
+.pure-button:focus {
+    /* csslint ignore:start */
+    filter: alpha(opacity=90);
+    /* csslint ignore:end */
+    background-image: -webkit-linear-gradient(transparent, rgba(0,0,0, 0.05) 40%, rgba(0,0,0, 0.10));
+    background-image: linear-gradient(transparent, rgba(0,0,0, 0.05) 40%, rgba(0,0,0, 0.10));
+}
+.pure-button:focus {
+    outline: 0;
+}
+.pure-button-active,
+.pure-button:active {
+    box-shadow: 0 0 0 1px rgba(0,0,0, 0.15) inset, 0 0 6px rgba(0,0,0, 0.20) inset;
+    border-color: #000\9;
+}
+
+.pure-button[disabled],
+.pure-button-disabled,
+.pure-button-disabled:hover,
+.pure-button-disabled:focus,
+.pure-button-disabled:active {
+    border: none;
+    background-image: none;
+    /* csslint ignore:start */
+    filter: alpha(opacity=40);
+    /* csslint ignore:end */
+    opacity: 0.40;
+    cursor: not-allowed;
+    box-shadow: none;
+    pointer-events: none;
+}
+
+.pure-button-hidden {
+    display: none;
+}
+
+.pure-button-primary,
+.pure-button-selected,
+a.pure-button-primary,
+a.pure-button-selected {
+    background-color: rgb(0, 120, 231);
+    color: #fff;
+}
+
+/* Button Groups */
+.pure-button-group .pure-button {
+    margin: 0;
+    border-radius: 0;
+    border-right: 1px solid #111;  /* fallback color for rgba() for IE7/8 */
+    border-right: 1px solid rgba(0, 0, 0, 0.2);
+
+}
+
+.pure-button-group .pure-button:first-child {
+    border-top-left-radius: 2px;
+    border-bottom-left-radius: 2px;
+}
+.pure-button-group .pure-button:last-child {
+    border-top-right-radius: 2px;
+    border-bottom-right-radius: 2px;
+    border-right: none;
+}
+
+/*csslint box-model:false*/
+/*
+Box-model set to false because we're setting a height on select elements, which
+also have border and padding. This is done because some browsers don't render
+the padding. We explicitly set the box-model for select elements to border-box,
+so we can ignore the csslint warning.
+*/
+
+.pure-form input[type="text"],
+.pure-form input[type="password"],
+.pure-form input[type="email"],
+.pure-form input[type="url"],
+.pure-form input[type="date"],
+.pure-form input[type="month"],
+.pure-form input[type="time"],
+.pure-form input[type="datetime"],
+.pure-form input[type="datetime-local"],
+.pure-form input[type="week"],
+.pure-form input[type="number"],
+.pure-form input[type="search"],
+.pure-form input[type="tel"],
+.pure-form input[type="color"],
+.pure-form select,
+.pure-form textarea {
+    padding: 0.5em 0.6em;
+    display: inline-block;
+    border: 1px solid #ccc;
+    box-shadow: inset 0 1px 3px #ddd;
+    border-radius: 4px;
+    vertical-align: middle;
+    box-sizing: border-box;
+}
+
+/*
+Need to separate out the :not() selector from the rest of the CSS 2.1 selectors
+since IE8 won't execute CSS that contains a CSS3 selector.
+*/
+.pure-form input:not([type]) {
+    padding: 0.5em 0.6em;
+    display: inline-block;
+    border: 1px solid #ccc;
+    box-shadow: inset 0 1px 3px #ddd;
+    border-radius: 4px;
+    box-sizing: border-box;
+}
+
+
+/* Chrome (as of v.32/34 on OS X) needs additional room for color to display. */
+/* May be able to remove this tweak as color inputs become more standardized across browsers. */
+.pure-form input[type="color"] {
+    padding: 0.2em 0.5em;
+}
+
+
+.pure-form input[type="text"]:focus,
+.pure-form input[type="password"]:focus,
+.pure-form input[type="email"]:focus,
+.pure-form input[type="url"]:focus,
+.pure-form input[type="date"]:focus,
+.pure-form input[type="month"]:focus,
+.pure-form input[type="time"]:focus,
+.pure-form input[type="datetime"]:focus,
+.pure-form input[type="datetime-local"]:focus,
+.pure-form input[type="week"]:focus,
+.pure-form input[type="number"]:focus,
+.pure-form input[type="search"]:focus,
+.pure-form input[type="tel"]:focus,
+.pure-form input[type="color"]:focus,
+.pure-form select:focus,
+.pure-form textarea:focus {
+    outline: 0;
+    border-color: #129FEA;
+}
+
+/*
+Need to separate out the :not() selector from the rest of the CSS 2.1 selectors
+since IE8 won't execute CSS that contains a CSS3 selector.
+*/
+.pure-form input:not([type]):focus {
+    outline: 0;
+    border-color: #129FEA;
+}
+
+.pure-form input[type="file"]:focus,
+.pure-form input[type="radio"]:focus,
+.pure-form input[type="checkbox"]:focus {
+    outline: thin solid #129FEA;
+    outline: 1px auto #129FEA;
+}
+.pure-form .pure-checkbox,
+.pure-form .pure-radio {
+    margin: 0.5em 0;
+    display: block;
+}
+
+.pure-form input[type="text"][disabled],
+.pure-form input[type="password"][disabled],
+.pure-form input[type="email"][disabled],
+.pure-form input[type="url"][disabled],
+.pure-form input[type="date"][disabled],
+.pure-form input[type="month"][disabled],
+.pure-form input[type="time"][disabled],
+.pure-form input[type="datetime"][disabled],
+.pure-form input[type="datetime-local"][disabled],
+.pure-form input[type="week"][disabled],
+.pure-form input[type="number"][disabled],
+.pure-form input[type="search"][disabled],
+.pure-form input[type="tel"][disabled],
+.pure-form input[type="color"][disabled],
+.pure-form select[disabled],
+.pure-form textarea[disabled] {
+    cursor: not-allowed;
+    background-color: #eaeded;
+    color: #cad2d3;
+}
+
+/*
+Need to separate out the :not() selector from the rest of the CSS 2.1 selectors
+since IE8 won't execute CSS that contains a CSS3 selector.
+*/
+.pure-form input:not([type])[disabled] {
+    cursor: not-allowed;
+    background-color: #eaeded;
+    color: #cad2d3;
+}
+.pure-form input[readonly],
+.pure-form select[readonly],
+.pure-form textarea[readonly] {
+    background-color: #eee; /* menu hover bg color */
+    color: #777; /* menu text color */
+    border-color: #ccc;
+}
+
+.pure-form input:focus:invalid,
+.pure-form textarea:focus:invalid,
+.pure-form select:focus:invalid {
+    color: #b94a48;
+    border-color: #e9322d;
+}
+.pure-form input[type="file"]:focus:invalid:focus,
+.pure-form input[type="radio"]:focus:invalid:focus,
+.pure-form input[type="checkbox"]:focus:invalid:focus {
+    outline-color: #e9322d;
+}
+.pure-form select {
+    /* Normalizes the height; padding is not sufficient. */
+    height: 2.25em;
+    border: 1px solid #ccc;
+    background-color: white;
+}
+.pure-form select[multiple] {
+    height: auto;
+}
+.pure-form label {
+    margin: 0.5em 0 0.2em;
+}
+.pure-form fieldset {
+    margin: 0;
+    padding: 0.35em 0 0.75em;
+    border: 0;
+}
+.pure-form legend {
+    display: block;
+    width: 100%;
+    padding: 0.3em 0;
+    margin-bottom: 0.3em;
+    color: #333;
+    border-bottom: 1px solid #e5e5e5;
+}
+
+.pure-form-stacked input[type="text"],
+.pure-form-stacked input[type="password"],
+.pure-form-stacked input[type="email"],
+.pure-form-stacked input[type="url"],
+.pure-form-stacked input[type="date"],
+.pure-form-stacked input[type="month"],
+.pure-form-stacked input[type="time"],
+.pure-form-stacked input[type="datetime"],
+.pure-form-stacked input[type="datetime-local"],
+.pure-form-stacked input[type="week"],
+.pure-form-stacked input[type="number"],
+.pure-form-stacked input[type="search"],
+.pure-form-stacked input[type="tel"],
+.pure-form-stacked input[type="color"],
+.pure-form-stacked input[type="file"],
+.pure-form-stacked select,
+.pure-form-stacked label,
+.pure-form-stacked textarea {
+    display: block;
+    margin: 0.25em 0;
+}
+
+/*
+Need to separate out the :not() selector from the rest of the CSS 2.1 selectors
+since IE8 won't execute CSS that contains a CSS3 selector.
+*/
+.pure-form-stacked input:not([type]) {
+    display: block;
+    margin: 0.25em 0;
+}
+.pure-form-aligned input,
+.pure-form-aligned textarea,
+.pure-form-aligned select,
+/* NOTE: pure-help-inline is deprecated. Use .pure-form-message-inline instead. */
+.pure-form-aligned .pure-help-inline,
+.pure-form-message-inline {
+    display: inline-block;
+    *display: inline;
+    *zoom: 1;
+    vertical-align: middle;
+}
+.pure-form-aligned textarea {
+    vertical-align: top;
+}
+
+/* Aligned Forms */
+.pure-form-aligned .pure-control-group {
+    margin-bottom: 0.5em;
+}
+.pure-form-aligned .pure-control-group label {
+    text-align: right;
+    display: inline-block;
+    vertical-align: middle;
+    width: 10em;
+    margin: 0 1em 0 0;
+}
+.pure-form-aligned .pure-controls {
+    margin: 1.5em 0 0 11em;
+}
+
+/* Rounded Inputs */
+.pure-form input.pure-input-rounded,
+.pure-form .pure-input-rounded {
+    border-radius: 2em;
+    padding: 0.5em 1em;
+}
+
+/* Grouped Inputs */
+.pure-form .pure-group fieldset {
+    margin-bottom: 10px;
+}
+.pure-form .pure-group input,
+.pure-form .pure-group textarea {
+    display: block;
+    padding: 10px;
+    margin: 0 0 -1px;
+    border-radius: 0;
+    position: relative;
+    top: -1px;
+}
+.pure-form .pure-group input:focus,
+.pure-form .pure-group textarea:focus {
+    z-index: 3;
+}
+.pure-form .pure-group input:first-child,
+.pure-form .pure-group textarea:first-child {
+    top: 1px;
+    border-radius: 4px 4px 0 0;
+    margin: 0;
+}
+.pure-form .pure-group input:first-child:last-child,
+.pure-form .pure-group textarea:first-child:last-child {
+    top: 1px;
+    border-radius: 4px;
+    margin: 0;
+}
+.pure-form .pure-group input:last-child,
+.pure-form .pure-group textarea:last-child {
+    top: -2px;
+    border-radius: 0 0 4px 4px;
+    margin: 0;
+}
+.pure-form .pure-group button {
+    margin: 0.35em 0;
+}
+
+.pure-form .pure-input-1 {
+    width: 100%;
+}
+.pure-form .pure-input-3-4 {
+    width: 75%;
+}
+.pure-form .pure-input-2-3 {
+    width: 66%;
+}
+.pure-form .pure-input-1-2 {
+    width: 50%;
+}
+.pure-form .pure-input-1-3 {
+    width: 33%;
+}
+.pure-form .pure-input-1-4 {
+    width: 25%;
+}
+
+/* Inline help for forms */
+/* NOTE: pure-help-inline is deprecated. Use .pure-form-message-inline instead. */
+.pure-form .pure-help-inline,
+.pure-form-message-inline {
+    display: inline-block;
+    padding-left: 0.3em;
+    color: #666;
+    vertical-align: middle;
+    font-size: 0.875em;
+}
+
+/* Block help for forms */
+.pure-form-message {
+    display: block;
+    color: #666;
+    font-size: 0.875em;
+}
+
+@media only screen and (max-width : 480px) {
+    .pure-form button[type="submit"] {
+        margin: 0.7em 0 0;
+    }
+
+    .pure-form input:not([type]),
+    .pure-form input[type="text"],
+    .pure-form input[type="password"],
+    .pure-form input[type="email"],
+    .pure-form input[type="url"],
+    .pure-form input[type="date"],
+    .pure-form input[type="month"],
+    .pure-form input[type="time"],
+    .pure-form input[type="datetime"],
+    .pure-form input[type="datetime-local"],
+    .pure-form input[type="week"],
+    .pure-form input[type="number"],
+    .pure-form input[type="search"],
+    .pure-form input[type="tel"],
+    .pure-form input[type="color"],
+    .pure-form label {
+        margin-bottom: 0.3em;
+        display: block;
+    }
+
+    .pure-group input:not([type]),
+    .pure-group input[type="text"],
+    .pure-group input[type="password"],
+    .pure-group input[type="email"],
+    .pure-group input[type="url"],
+    .pure-group input[type="date"],
+    .pure-group input[type="month"],
+    .pure-group input[type="time"],
+    .pure-group input[type="datetime"],
+    .pure-group input[type="datetime-local"],
+    .pure-group input[type="week"],
+    .pure-group input[type="number"],
+    .pure-group input[type="search"],
+    .pure-group input[type="tel"],
+    .pure-group input[type="color"] {
+        margin-bottom: 0;
+    }
+
+    .pure-form-aligned .pure-control-group label {
+        margin-bottom: 0.3em;
+        text-align: left;
+        display: block;
+        width: 100%;
+    }
+
+    .pure-form-aligned .pure-controls {
+        margin: 1.5em 0 0 0;
+    }
+
+    /* NOTE: pure-help-inline is deprecated. Use .pure-form-message-inline instead. */
+    .pure-form .pure-help-inline,
+    .pure-form-message-inline,
+    .pure-form-message {
+        display: block;
+        font-size: 0.75em;
+        /* Increased bottom padding to make it group with its related input element. */
+        padding: 0.2em 0 0.8em;
+    }
+}
+
+/*csslint adjoining-classes: false, box-model:false*/
+.pure-menu {
+    box-sizing: border-box;
+}
+
+.pure-menu-fixed {
+    position: fixed;
+    left: 0;
+    top: 0;
+    z-index: 3;
+}
+
+.pure-menu-list,
+.pure-menu-item {
+    position: relative;
+}
+
+.pure-menu-list {
+    list-style: none;
+    margin: 0;
+    padding: 0;
+}
+
+.pure-menu-item {
+    padding: 0;
+    margin: 0;
+    height: 100%;
+}
+
+.pure-menu-link,
+.pure-menu-heading {
+    display: block;
+    text-decoration: none;
+    white-space: nowrap;
+}
+
+/* HORIZONTAL MENU */
+.pure-menu-horizontal {
+    width: 100%;
+    white-space: nowrap;
+}
+
+.pure-menu-horizontal .pure-menu-list {
+    display: inline-block;
+}
+
+/* Initial menus should be inline-block so that they are horizontal */
+.pure-menu-horizontal .pure-menu-item,
+.pure-menu-horizontal .pure-menu-heading,
+.pure-menu-horizontal .pure-menu-separator {
+    display: inline-block;
+    *display: inline;
+    zoom: 1;
+    vertical-align: middle;
+}
+
+/* Submenus should still be display: block; */
+.pure-menu-item .pure-menu-item {
+    display: block;
+}
+
+.pure-menu-children {
+    display: none;
+    position: absolute;
+    left: 100%;
+    top: 0;
+    margin: 0;
+    padding: 0;
+    z-index: 3;
+}
+
+.pure-menu-horizontal .pure-menu-children {
+    left: 0;
+    top: auto;
+    width: inherit;
+}
+
+.pure-menu-allow-hover:hover > .pure-menu-children,
+.pure-menu-active > .pure-menu-children {
+    display: block;
+    position: absolute;
+}
+
+/* Vertical Menus - show the dropdown arrow */
+.pure-menu-has-children > .pure-menu-link:after {
+    padding-left: 0.5em;
+    content: "\25B8";
+    font-size: small;
+}
+
+/* Horizontal Menus - show the dropdown arrow */
+.pure-menu-horizontal .pure-menu-has-children > .pure-menu-link:after {
+    content: "\25BE";
+}
+
+/* scrollable menus */
+.pure-menu-scrollable {
+    overflow-y: scroll;
+    overflow-x: hidden;
+}
+
+.pure-menu-scrollable .pure-menu-list {
+    display: block;
+}
+
+.pure-menu-horizontal.pure-menu-scrollable .pure-menu-list {
+    display: inline-block;
+}
+
+.pure-menu-horizontal.pure-menu-scrollable {
+    white-space: nowrap;
+    overflow-y: hidden;
+    overflow-x: auto;
+    -ms-overflow-style: none;
+    -webkit-overflow-scrolling: touch;
+    /* a little extra padding for this style to allow for scrollbars */
+    padding: .5em 0;
+}
+
+.pure-menu-horizontal.pure-menu-scrollable::-webkit-scrollbar {
+    display: none;
+}
+
+/* misc default styling */
+
+.pure-menu-separator,
+.pure-menu-horizontal .pure-menu-children .pure-menu-separator {
+    background-color: #ccc;
+    height: 1px;
+    margin: .3em 0;
+}
+
+.pure-menu-horizontal .pure-menu-separator {
+    width: 1px;
+    height: 1.3em;
+    margin: 0 .3em ;
+}
+
+/* Need to reset the separator since submenu is vertical */
+.pure-menu-horizontal .pure-menu-children .pure-menu-separator {
+    display: block;
+    width: auto;
+}
+
+.pure-menu-heading {
+    text-transform: uppercase;
+    color: #565d64;
+}
+
+.pure-menu-link {
+    color: #777;
+}
+
+.pure-menu-children {
+    background-color: #fff;
+}
+
+.pure-menu-link,
+.pure-menu-disabled,
+.pure-menu-heading {
+    padding: .5em 1em;
+}
+
+.pure-menu-disabled {
+    opacity: .5;
+}
+
+.pure-menu-disabled .pure-menu-link:hover {
+    background-color: transparent;
+}
+
+.pure-menu-active > .pure-menu-link,
+.pure-menu-link:hover,
+.pure-menu-link:focus {
+    background-color: #eee;
+}
+
+.pure-menu-selected .pure-menu-link,
+.pure-menu-selected .pure-menu-link:visited {
+    color: #000;
+}
+
+.pure-table {
+    /* Remove spacing between table cells (from Normalize.css) */
+    border-collapse: collapse;
+    border-spacing: 0;
+    empty-cells: show;
+    border: 1px solid #cbcbcb;
+}
+
+.pure-table caption {
+    color: #000;
+    font: italic 85%/1 arial, sans-serif;
+    padding: 1em 0;
+    text-align: center;
+}
+
+.pure-table td,
+.pure-table th {
+    border-left: 1px solid #cbcbcb;/*  inner column border */
+    border-width: 0 0 0 1px;
+    font-size: inherit;
+    margin: 0;
+    overflow: visible; /*to make ths where the title is really long work*/
+    padding: 0.5em 1em; /* cell padding */
+}
+
+/* Consider removing this next declaration block, as it causes problems when
+there's a rowspan on the first cell. Case added to the tests. issue#432 */
+.pure-table td:first-child,
+.pure-table th:first-child {
+    border-left-width: 0;
+}
+
+.pure-table thead {
+    background-color: #e0e0e0;
+    color: #000;
+    text-align: left;
+    vertical-align: bottom;
+}
+
+/*
+striping:
+   even - #fff (white)
+   odd  - #f2f2f2 (light gray)
+*/
+.pure-table td {
+    background-color: transparent;
+}
+.pure-table-odd td {
+    background-color: #f2f2f2;
+}
+
+/* nth-child selector for modern browsers */
+.pure-table-striped tr:nth-child(2n-1) td {
+    background-color: #f2f2f2;
+}
+
+/* BORDERED TABLES */
+.pure-table-bordered td {
+    border-bottom: 1px solid #cbcbcb;
+}
+.pure-table-bordered tbody > tr:last-child > td {
+    border-bottom-width: 0;
+}
+
+
+/* HORIZONTAL BORDERED TABLES */
+
+.pure-table-horizontal td,
+.pure-table-horizontal th {
+    border-width: 0 0 1px 0;
+    border-bottom: 1px solid #cbcbcb;
+}
+.pure-table-horizontal tbody > tr:last-child > td {
+    border-bottom-width: 0;
+}
diff --git a/src/webex/style/wallet.css b/src/webex/style/wallet.css
new file mode 100644
index 000000000..752fc6d75
--- /dev/null
+++ b/src/webex/style/wallet.css
@@ -0,0 +1,222 @@
+#main {
+    border: solid 1px black;
+    border-radius: 10px;
+    margin-left: auto;
+    margin-right: auto;
+    margin-top: 2em;
+    max-width: 50%;
+    padding: 2em;
+}
+
+header {
+    width: 100%;
+    height: 100px;
+    margin: 0;
+    padding: 0;
+    border-bottom: 1px solid black;
+}
+
+header h1 {
+    font-size: 200%;
+    margin: 0;
+    padding: 0 0 0 120px;
+    position: relative;
+    top: 50%;
+    transform: translateY(-50%);
+}
+
+header #logo {
+    float: left;
+    width: 100px;
+    height: 100px;
+    padding: 0;
+    margin: 0;
+    text-align: center;
+    border-right: 1px solid black;
+    background-image: url(/img/logo.png);
+    background-size: 100px;
+}
+
+aside {
+    width: 100px;
+    float: left;
+}
+
+section#main {
+    margin: auto;
+    padding: 20px;
+    border-left: 1px solid black;
+    height: 100%;
+    max-width: 50%;
+}
+
+section#main h1:first-child {
+    margin-top: 0;
+}
+
+h1 {
+    font-size: 160%;
+}
+
+h2 {
+    font-size: 140%;
+}
+
+h3 {
+    font-size: 120%;
+}
+
+h4, h5, h6 {
+    font-size: 100%;
+}
+
+.form-row {
+  padding-top: 5px;
+  padding-bottom: 5px;
+}
+
+label {
+  padding-right: 1em;
+}
+
+label::after {
+  content: ":";
+}
+
+input.url {
+  width: 25em;
+}
+
+.formish {
+}
+
+.json-key {
+   color: brown;
+}
+.json-value {
+   color: navy;
+   }
+.json-string {
+   color: olive;
+}
+
+button {
+    font-size: 120%;
+    padding: 0.5em;
+}
+
+button.confirm-pay {
+    float: right;
+}
+
+/* We use fading to hide slower DOM updates */
+.fade {
+    -webkit-animation: fade 0.7s;
+    animation: fade 0.7s;
+    opacity: 1;
+}
+
+@-webkit-keyframes fade {
+    from {opacity: 0}
+    to {opacity: 1}
+}
+@keyframes fade {
+     from {opacity: 0}
+     to {opacity: 1}
+ }
+
+button.linky {
+    background:none!important;
+    border:none;
+    padding:0!important;
+
+    font-family:arial,sans-serif;
+    color:#069;
+    text-decoration:underline;
+    cursor:pointer;
+}
+
+table, th, td {
+    border: 1px solid black;
+}
+
+
+button.accept {
+  background-color: #5757D2;
+  border: 1px solid black;
+  border-radius: 5px;
+  margin: 1em 0;
+  padding: 0.5em;
+  font-weight: bold;
+  color: white;
+}
+button.linky {
+  background:none!important;
+  border:none;
+  padding:0!important;
+
+  font-family:arial,sans-serif;
+  color:#069;
+  text-decoration:underline;
+  cursor:pointer;
+}
+
+
+button.accept:disabled {
+  background-color: #dedbe8;
+  border: 1px solid white;
+  border-radius: 5px;
+  margin: 1em 0;
+  padding: 0.5em;
+  font-weight: bold;
+  color: #2C2C2C;
+}
+
+input.url {
+  width: 25em;
+}
+
+table {
+  border-collapse: collapse;
+}
+
+td {
+  border-left: 1px solid black;
+  border-right: 1px solid black;
+  text-align: center;
+  padding: 0.3em;
+}
+
+span.spacer {
+  padding-left: 0.5em;
+  padding-right: 0.5em;
+}
+
+.button-success,
+.button-destructive,
+.button-warning,
+.button-secondary {
+    color: white;
+    border-radius: 4px;
+    text-shadow: 0 1px 1px rgba(0, 0, 0, 0.2);
+}
+
+.button-success {
+    background: rgb(28, 184, 65);
+}
+
+.button-destructive {
+    background: rgb(202, 60, 60);
+}
+
+.button-warning {
+    background: rgb(223, 117, 20);
+}
+
+.button-secondary {
+    background: rgb(66, 184, 221);
+}
+
+a.actionLink {
+  color: black;
+}
diff --git a/src/webex/wxApi.ts b/src/webex/wxApi.ts
new file mode 100644
index 000000000..e5a502406
--- /dev/null
+++ b/src/webex/wxApi.ts
@@ -0,0 +1,174 @@
+/*
+ This file is part of TALER
+ (C) 2016 GNUnet e.V.
+
+ TALER is free software; you can redistribute it and/or modify it under the
+ terms of the GNU General Public License as published by the Free Software
+ Foundation; either version 3, or (at your option) any later version.
+
+ TALER is distributed in the hope that it will be useful, but WITHOUT ANY
+ WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR
+ A PARTICULAR PURPOSE.  See the GNU General Public License for more details.
+
+ You should have received a copy of the GNU General Public License along with
+ TALER; see the file COPYING.  If not, see <http://www.gnu.org/licenses/>
+ */
+
+/**
+ * Interface to the wallet through WebExtension messaging.
+ */
+
+
+/**
+ * Imports.
+ */
+import {
+  AmountJson,
+  CoinRecord,
+  CurrencyRecord,
+  DenominationRecord,
+  ExchangeRecord,
+  PreCoinRecord,
+  ReserveCreationInfo,
+  ReserveRecord,
+} from "../types";
+
+
+/**
+ * Query the wallet for the coins that would be used to withdraw
+ * from a given reserve.
+ */
+export function getReserveCreationInfo(baseUrl: string,
+                                       amount: AmountJson): Promise<ReserveCreationInfo> {
+  const m = { type: "reserve-creation-info", detail: { baseUrl, amount } };
+  return new Promise<ReserveCreationInfo>((resolve, reject) => {
+    chrome.runtime.sendMessage(m, (resp) => {
+      if (resp.error) {
+        console.error("error response", resp);
+        const e = Error("call to reserve-creation-info failed");
+        (e as any).errorResponse = resp;
+        reject(e);
+        return;
+      }
+      resolve(resp);
+    });
+  });
+}
+
+
+async function callBackend(type: string, detail?: any): Promise<any> {
+  return new Promise<any>((resolve, reject) => {
+    chrome.runtime.sendMessage({ type, detail }, (resp) => {
+      if (resp && resp.error) {
+        reject(resp);
+      } else {
+        resolve(resp);
+      }
+    });
+  });
+}
+
+
+/**
+ * Get all exchanges the wallet knows about.
+ */
+export async function getExchanges(): Promise<ExchangeRecord[]> {
+  return await callBackend("get-exchanges");
+}
+
+
+/**
+ * Get all currencies the exchange knows about.
+ */
+export async function getCurrencies(): Promise<CurrencyRecord[]> {
+  return await callBackend("get-currencies");
+}
+
+
+/**
+ * Get information about a specific currency.
+ */
+export async function getCurrency(name: string): Promise<CurrencyRecord|null> {
+  return await callBackend("currency-info", {name});
+}
+
+
+/**
+ * Get information about a specific exchange.
+ */
+export async function getExchangeInfo(baseUrl: string): Promise<ExchangeRecord> {
+  return await callBackend("exchange-info", {baseUrl});
+}
+
+
+/**
+ * Replace an existing currency record with the one given.  The currency to
+ * replace is specified inside the currency record.
+ */
+export async function updateCurrency(currencyRecord: CurrencyRecord): Promise<void> {
+  return await callBackend("update-currency", { currencyRecord });
+}
+
+
+/**
+ * Get all reserves the wallet has at an exchange.
+ */
+export async function getReserves(exchangeBaseUrl: string): Promise<ReserveRecord[]> {
+  return await callBackend("get-reserves", { exchangeBaseUrl });
+}
+
+
+/**
+ * Get all reserves for which a payback is available.
+ */
+export async function getPaybackReserves(): Promise<ReserveRecord[]> {
+  return await callBackend("get-payback-reserves");
+}
+
+
+/**
+ * Withdraw the payback that is available for a reserve.
+ */
+export async function withdrawPaybackReserve(reservePub: string): Promise<ReserveRecord[]> {
+  return await callBackend("withdraw-payback-reserve", { reservePub });
+}
+
+
+/**
+ * Get all coins withdrawn from the given exchange.
+ */
+export async function getCoins(exchangeBaseUrl: string): Promise<CoinRecord[]> {
+  return await callBackend("get-coins", { exchangeBaseUrl });
+}
+
+
+/**
+ * Get all precoins withdrawn from the given exchange.
+ */
+export async function getPreCoins(exchangeBaseUrl: string): Promise<PreCoinRecord[]> {
+  return await callBackend("get-precoins", { exchangeBaseUrl });
+}
+
+
+/**
+ * Get all denoms offered by the given exchange.
+ */
+export async function getDenoms(exchangeBaseUrl: string): Promise<DenominationRecord[]> {
+  return await callBackend("get-denoms", { exchangeBaseUrl });
+}
+
+
+/**
+ * Start refreshing a coin.
+ */
+export async function refresh(coinPub: string): Promise<void> {
+  return await callBackend("refresh-coin", { coinPub });
+}
+
+
+/**
+ * Request payback for a coin.  Only works for non-refreshed coins.
+ */
+export async function payback(coinPub: string): Promise<void> {
+  return await callBackend("payback-coin", { coinPub });
+}
diff --git a/src/webex/wxBackend.ts b/src/webex/wxBackend.ts
new file mode 100644
index 000000000..35e1ff938
--- /dev/null
+++ b/src/webex/wxBackend.ts
@@ -0,0 +1,719 @@
+/*
+ This file is part of TALER
+ (C) 2016 GNUnet e.V.
+
+ TALER is free software; you can redistribute it and/or modify it under the
+ terms of the GNU General Public License as published by the Free Software
+ Foundation; either version 3, or (at your option) any later version.
+
+ TALER is distributed in the hope that it will be useful, but WITHOUT ANY
+ WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR
+ A PARTICULAR PURPOSE.  See the GNU General Public License for more details.
+
+ You should have received a copy of the GNU General Public License along with
+ TALER; see the file COPYING.  If not, see <http://www.gnu.org/licenses/>
+ */
+
+/**
+ * Messaging for the WebExtensions wallet.  Should contain
+ * parts that are specific for WebExtensions, but as little business
+ * logic as possible.
+ */
+
+
+/**
+ * Imports.
+ */
+import { Checkable } from "../checkable";
+import { BrowserHttpLib } from "../http";
+import * as logging from "../logging";
+import {
+  Index,
+  Store,
+} from "../query";
+import {
+  AmountJson,
+  Contract,
+  Notifier,
+} from "../types";
+import {
+  Badge,
+  ConfirmReserveRequest,
+  CreateReserveRequest,
+  OfferRecord,
+  Stores,
+  Wallet,
+} from "../wallet";
+
+import { ChromeBadge } from "./chromeBadge";
+import URI = require("urijs");
+import Port = chrome.runtime.Port;
+import MessageSender = chrome.runtime.MessageSender;
+
+
+const DB_NAME = "taler";
+
+/**
+ * Current database version, should be incremented
+ * each time we do incompatible schema changes on the database.
+ * In the future we might consider adding migration functions for
+ * each version increment.
+ */
+const DB_VERSION = 17;
+
+type Handler = (detail: any, sender: MessageSender) => Promise<any>;
+
+function makeHandlers(db: IDBDatabase,
+                      wallet: Wallet): { [msg: string]: Handler } {
+  return {
+    ["balances"]: (detail, sender) => {
+      return wallet.getBalances();
+    },
+    ["dump-db"]: (detail, sender) => {
+      return exportDb(db);
+    },
+    ["import-db"]: (detail, sender) => {
+      return importDb(db, detail.dump);
+    },
+    ["get-tab-cookie"]: (detail, sender) => {
+      if (!sender || !sender.tab || !sender.tab.id) {
+        return Promise.resolve();
+      }
+      const id: number = sender.tab.id;
+      const info: any = paymentRequestCookies[id] as any;
+      delete paymentRequestCookies[id];
+      return Promise.resolve(info);
+    },
+    ["ping"]: (detail, sender) => {
+      return Promise.resolve();
+    },
+    ["reset"]: (detail, sender) => {
+      if (db) {
+        const tx = db.transaction(Array.from(db.objectStoreNames), "readwrite");
+        // tslint:disable-next-line:prefer-for-of
+        for (let i = 0; i < db.objectStoreNames.length; i++) {
+          tx.objectStore(db.objectStoreNames[i]).clear();
+        }
+      }
+      deleteDb();
+
+      chrome.browserAction.setBadgeText({ text: "" });
+      console.log("reset done");
+      // Response is synchronous
+      return Promise.resolve({});
+    },
+    ["create-reserve"]: (detail, sender) => {
+      const d = {
+        amount: detail.amount,
+        exchange: detail.exchange,
+      };
+      const req = CreateReserveRequest.checked(d);
+      return wallet.createReserve(req);
+    },
+    ["confirm-reserve"]: (detail, sender) => {
+      // TODO: make it a checkable
+      const d = {
+        reservePub: detail.reservePub,
+      };
+      const req = ConfirmReserveRequest.checked(d);
+      return wallet.confirmReserve(req);
+    },
+    ["generate-nonce"]: (detail, sender) => {
+      return wallet.generateNonce();
+    },
+    ["confirm-pay"]: (detail, sender) => {
+      let offer: OfferRecord;
+      try {
+        offer = OfferRecord.checked(detail.offer);
+      } catch (e) {
+        if (e instanceof Checkable.SchemaError) {
+          console.error("schema error:", e.message);
+          return Promise.resolve({
+            detail,
+            error: "invalid contract",
+            hint: e.message,
+          });
+        } else {
+          throw e;
+        }
+      }
+
+      return wallet.confirmPay(offer);
+    },
+    ["check-pay"]: (detail, sender) => {
+      let offer: OfferRecord;
+      try {
+        offer = OfferRecord.checked(detail.offer);
+      } catch (e) {
+        if (e instanceof Checkable.SchemaError) {
+          console.error("schema error:", e.message);
+          return Promise.resolve({
+            detail,
+            error: "invalid contract",
+            hint: e.message,
+          });
+        } else {
+          throw e;
+        }
+      }
+      return wallet.checkPay(offer);
+    },
+    ["query-payment"]: (detail: any, sender: MessageSender) => {
+      if (sender.tab && sender.tab.id) {
+        rateLimitCache[sender.tab.id]++;
+        if (rateLimitCache[sender.tab.id] > 10) {
+          console.warn("rate limit for query-payment exceeded");
+          const msg = {
+            error: "rate limit exceeded for query-payment",
+            hint: "Check for redirect loops",
+            rateLimitExceeded: true,
+          };
+          return Promise.resolve(msg);
+        }
+      }
+      return wallet.queryPayment(detail.url);
+    },
+    ["exchange-info"]: (detail) => {
+      if (!detail.baseUrl) {
+        return Promise.resolve({ error: "bad url" });
+      }
+      return wallet.updateExchangeFromUrl(detail.baseUrl);
+    },
+    ["currency-info"]: (detail) => {
+      if (!detail.name) {
+        return Promise.resolve({ error: "name missing" });
+      }
+      return wallet.getCurrencyRecord(detail.name);
+    },
+    ["hash-contract"]: (detail) => {
+      if (!detail.contract) {
+        return Promise.resolve({ error: "contract missing" });
+      }
+      return wallet.hashContract(detail.contract).then((hash) => {
+        return { hash };
+      });
+    },
+    ["put-history-entry"]: (detail: any) => {
+      if (!detail.historyEntry) {
+        return Promise.resolve({ error: "historyEntry missing" });
+      }
+      return wallet.putHistory(detail.historyEntry);
+    },
+    ["save-offer"]: (detail: any) => {
+      const offer = detail.offer;
+      if (!offer) {
+        return Promise.resolve({ error: "offer missing" });
+      }
+      console.log("handling safe-offer", detail);
+      // FIXME:  fully migrate to new terminology
+      const checkedOffer = OfferRecord.checked(offer);
+      return wallet.saveOffer(checkedOffer);
+    },
+    ["reserve-creation-info"]: (detail, sender) => {
+      if (!detail.baseUrl || typeof detail.baseUrl !== "string") {
+        return Promise.resolve({ error: "bad url" });
+      }
+      const amount = AmountJson.checked(detail.amount);
+      return wallet.getReserveCreationInfo(detail.baseUrl, amount);
+    },
+    ["get-history"]: (detail, sender) => {
+      // TODO: limit history length
+      return wallet.getHistory();
+    },
+    ["get-offer"]: (detail, sender) => {
+      return wallet.getOffer(detail.offerId);
+    },
+    ["get-exchanges"]: (detail, sender) => {
+      return wallet.getExchanges();
+    },
+    ["get-currencies"]: (detail, sender) => {
+      return wallet.getCurrencies();
+    },
+    ["update-currency"]: (detail, sender) => {
+      return wallet.updateCurrency(detail.currencyRecord);
+    },
+    ["get-reserves"]: (detail, sender) => {
+      if (typeof detail.exchangeBaseUrl !== "string") {
+        return Promise.reject(Error("exchangeBaseUrl missing"));
+      }
+      return wallet.getReserves(detail.exchangeBaseUrl);
+    },
+    ["get-payback-reserves"]: (detail, sender) => {
+      return wallet.getPaybackReserves();
+    },
+    ["withdraw-payback-reserve"]: (detail, sender) => {
+      if (typeof detail.reservePub !== "string") {
+        return Promise.reject(Error("reservePub missing"));
+      }
+      return wallet.withdrawPaybackReserve(detail.reservePub);
+    },
+    ["get-coins"]: (detail, sender) => {
+      if (typeof detail.exchangeBaseUrl !== "string") {
+        return Promise.reject(Error("exchangBaseUrl missing"));
+      }
+      return wallet.getCoins(detail.exchangeBaseUrl);
+    },
+    ["get-precoins"]: (detail, sender) => {
+      if (typeof detail.exchangeBaseUrl !== "string") {
+        return Promise.reject(Error("exchangBaseUrl missing"));
+      }
+      return wallet.getPreCoins(detail.exchangeBaseUrl);
+    },
+    ["get-denoms"]: (detail, sender) => {
+      if (typeof detail.exchangeBaseUrl !== "string") {
+        return Promise.reject(Error("exchangBaseUrl missing"));
+      }
+      return wallet.getDenoms(detail.exchangeBaseUrl);
+    },
+    ["refresh-coin"]: (detail, sender) => {
+      if (typeof detail.coinPub !== "string") {
+        return Promise.reject(Error("coinPub missing"));
+      }
+      return wallet.refresh(detail.coinPub);
+    },
+    ["payback-coin"]: (detail, sender) => {
+      if (typeof detail.coinPub !== "string") {
+        return Promise.reject(Error("coinPub missing"));
+      }
+      return wallet.payback(detail.coinPub);
+    },
+    ["payment-failed"]: (detail, sender) => {
+      // For now we just update exchanges (maybe the exchange did something
+      // wrong and the keys were messed up).
+      // FIXME: in the future we should look at what actually went wrong.
+      console.error("payment reported as failed");
+      wallet.updateExchanges();
+      return Promise.resolve();
+    },
+    ["payment-succeeded"]: (detail, sender) => {
+      const contractHash = detail.contractHash;
+      const merchantSig = detail.merchantSig;
+      if (!contractHash) {
+        return Promise.reject(Error("contractHash missing"));
+      }
+      if (!merchantSig) {
+        return Promise.reject(Error("merchantSig missing"));
+      }
+      return wallet.paymentSucceeded(contractHash, merchantSig);
+    },
+  };
+}
+
+
+async function dispatch(handlers: any, req: any, sender: any, sendResponse: any): Promise<void> {
+  if (!(req.type in handlers)) {
+    console.error(`Request type ${JSON.stringify(req)} unknown, req ${req.type}`);
+    try {
+      sendResponse({ error: "request unknown" });
+    } catch (e) {
+      // might fail if tab disconnected
+    }
+  }
+
+  try {
+    const p = handlers[req.type](req.detail, sender);
+    const r = await p;
+    try {
+      sendResponse(r);
+    } catch (e) {
+      // might fail if tab disconnected
+    }
+  } catch (e) {
+    console.log(`exception during wallet handler for '${req.type}'`);
+    console.log("request", req);
+    console.error(e);
+    let stack;
+    try {
+      stack = e.stack.toString();
+    } catch (e) {
+      // might fail
+    }
+    try {
+      sendResponse({
+        error: "exception",
+        hint: e.message,
+        stack,
+      });
+    } catch (e) {
+      console.log(e);
+      // might fail if tab disconnected
+    }
+  }
+}
+
+
+class ChromeNotifier implements Notifier {
+  private ports: Port[] = [];
+
+  constructor() {
+    chrome.runtime.onConnect.addListener((port) => {
+      console.log("got connect!");
+      this.ports.push(port);
+      port.onDisconnect.addListener(() => {
+        const i = this.ports.indexOf(port);
+        if (i >= 0) {
+          this.ports.splice(i, 1);
+        } else {
+          console.error("port already removed");
+        }
+      });
+    });
+  }
+
+  notify() {
+    for (const p of this.ports) {
+      p.postMessage({ notify: true });
+    }
+  }
+}
+
+
+/**
+ * Mapping from tab ID to payment information (if any).
+ */
+const paymentRequestCookies: { [n: number]: any } = {};
+
+
+/**
+ * Handle a HTTP response that has the "402 Payment Required" status.
+ * In this callback we don't have access to the body, and must communicate via
+ * shared state with the content script that will later be run later
+ * in this tab.
+ */
+function handleHttpPayment(headerList: chrome.webRequest.HttpHeader[], url: string, tabId: number): any {
+  const headers: { [s: string]: string } = {};
+  for (const kv of headerList) {
+    if (kv.value) {
+      headers[kv.name.toLowerCase()] = kv.value;
+    }
+  }
+
+  const fields = {
+    contract_query: headers["x-taler-contract-query"],
+    contract_url: headers["x-taler-contract-url"],
+    offer_url: headers["x-taler-offer-url"],
+  };
+
+  const talerHeaderFound = Object.keys(fields).filter((x: any) => (fields as any)[x]).length !== 0;
+
+  if (!talerHeaderFound) {
+    // looks like it's not a taler request, it might be
+    // for a different payment system (or the shop is buggy)
+    console.log("ignoring non-taler 402 response");
+    return;
+  }
+
+  const payDetail = {
+    contract_url: fields.contract_url,
+    offer_url: fields.offer_url,
+  };
+
+  console.log("got pay detail", payDetail);
+
+  // This cookie will be read by the injected content script
+  // in the tab that displays the page.
+  paymentRequestCookies[tabId] = {
+    payDetail,
+    type: "pay",
+  };
+}
+
+
+function handleBankRequest(wallet: Wallet, headerList: chrome.webRequest.HttpHeader[],
+                           url: string, tabId: number): any {
+  const headers: { [s: string]: string } = {};
+  for (const kv of headerList) {
+    if (kv.value) {
+      headers[kv.name.toLowerCase()] = kv.value;
+    }
+  }
+
+  const reservePub = headers["x-taler-reserve-pub"];
+  if (reservePub !== undefined) {
+    console.log(`confirming reserve ${reservePub} via 201`);
+    wallet.confirmReserve({reservePub});
+    return;
+  }
+
+  const amount = headers["x-taler-amount"];
+  if (amount) {
+    const callbackUrl = headers["x-taler-callback-url"];
+    if (!callbackUrl) {
+      console.log("202 not understood (X-Taler-Callback-Url missing)");
+      return;
+    }
+    let amountParsed;
+    try {
+      amountParsed = JSON.parse(amount);
+    } catch (e) {
+      const uri = new URI(chrome.extension.getURL("/src/pages/error.html"));
+      const p = {
+        message: `Can't parse amount ("${amount}"): ${e.message}`,
+      };
+      const redirectUrl = uri.query(p).href();
+      // FIXME: use direct redirect when https://bugzilla.mozilla.org/show_bug.cgi?id=707624 is fixed
+      chrome.tabs.update(tabId, {url: redirectUrl});
+      return;
+    }
+    const wtTypes = headers["x-taler-wt-types"];
+    if (!wtTypes) {
+      console.log("202 not understood (X-Taler-Wt-Types missing)");
+      return;
+    }
+    const params = {
+      amount,
+      bank_url: url,
+      callback_url: new URI(callbackUrl) .absoluteTo(url),
+      suggested_exchange_url: headers["x-taler-suggested-exchange"],
+      wt_types: wtTypes,
+    };
+    const uri = new URI(chrome.extension.getURL("/src/pages/confirm-create-reserve.html"));
+    const redirectUrl = uri.query(params).href();
+    console.log("redirecting to", redirectUrl);
+    // FIXME: use direct redirect when https://bugzilla.mozilla.org/show_bug.cgi?id=707624 is fixed
+    chrome.tabs.update(tabId, {url: redirectUrl});
+    return;
+  }
+  // no known headers found, not a taler request ...
+}
+
+
+// Rate limit cache for executePayment operations, to break redirect loops
+let rateLimitCache: { [n: number]: number } = {};
+
+function clearRateLimitCache() {
+  rateLimitCache = {};
+}
+
+/**
+ * Main function to run for the WebExtension backend.
+ *
+ * Sets up all event handlers and other machinery.
+ */
+export async function wxMain() {
+  window.onerror = (m, source, lineno, colno, error) => {
+    logging.record("error", m + error, undefined, source || "(unknown)", lineno || 0, colno || 0);
+  };
+
+  chrome.browserAction.setBadgeText({ text: "" });
+  const badge = new ChromeBadge();
+
+  chrome.tabs.query({}, (tabs) => {
+    for (const tab of tabs) {
+      if (!tab.url || !tab.id) {
+        return;
+      }
+      const uri = new URI(tab.url);
+      if (uri.protocol() === "http" || uri.protocol() === "https") {
+        console.log("injecting into existing tab", tab.id);
+        chrome.tabs.executeScript(tab.id, { file: "/dist/contentScript-bundle.js" });
+        const code = `
+          if (("taler" in window) || document.documentElement.getAttribute("data-taler-nojs")) {
+            document.dispatchEvent(new Event("taler-probe-result"));
+          }
+        `;
+        chrome.tabs.executeScript(tab.id, { code, runAt: "document_idle" });
+      }
+    }
+  });
+
+  const tabTimers: {[n: number]: number[]} = {};
+
+  chrome.tabs.onRemoved.addListener((tabId, changeInfo) => {
+    const tt = tabTimers[tabId] || [];
+    for (const t of tt) {
+      chrome.extension.getBackgroundPage().clearTimeout(t);
+    }
+  });
+  chrome.tabs.onUpdated.addListener((tabId, changeInfo) => {
+    if (changeInfo.status !== "complete") {
+      return;
+    }
+    const timers: number[] = [];
+
+    const addRun = (dt: number) => {
+      const id = chrome.extension.getBackgroundPage().setTimeout(run, dt);
+      timers.push(id);
+    };
+
+    const run = () => {
+      timers.shift();
+      chrome.tabs.get(tabId, (tab) => {
+        if (chrome.runtime.lastError) {
+          return;
+        }
+        if (!tab.url || !tab.id) {
+          return;
+        }
+        const uri = new URI(tab.url);
+        if (!(uri.protocol() === "http" || uri.protocol() === "https")) {
+          return;
+        }
+        const code = `
+          if (("taler" in window) || document.documentElement.getAttribute("data-taler-nojs")) {
+            document.dispatchEvent(new Event("taler-probe-result"));
+          }
+        `;
+        chrome.tabs.executeScript(tab.id!, { code, runAt: "document_start" });
+      });
+    };
+
+    addRun(0);
+    addRun(50);
+    addRun(300);
+    addRun(1000);
+    addRun(2000);
+    addRun(4000);
+    addRun(8000);
+    addRun(16000);
+    tabTimers[tabId] = timers;
+  });
+
+  chrome.extension.getBackgroundPage().setInterval(clearRateLimitCache, 5000);
+
+  let db: IDBDatabase;
+  try {
+    db = await openTalerDb();
+  } catch (e) {
+    console.error("could not open database", e);
+    return;
+  }
+  const http = new BrowserHttpLib();
+  const notifier = new ChromeNotifier();
+  console.log("setting wallet");
+  const wallet = new Wallet(db, http, badge!, notifier);
+  // Useful for debugging in the background page.
+  (window as any).talerWallet = wallet;
+
+  // Handlers for messages coming directly from the content
+  // script on the page
+  const handlers = makeHandlers(db, wallet!);
+  chrome.runtime.onMessage.addListener((req, sender, sendResponse) => {
+    dispatch(handlers, req, sender, sendResponse);
+    return true;
+  });
+
+  // Handlers for catching HTTP requests
+  chrome.webRequest.onHeadersReceived.addListener((details) => {
+    if (details.statusCode === 402) {
+      console.log(`got 402 from ${details.url}`);
+      return handleHttpPayment(details.responseHeaders || [],
+        details.url,
+        details.tabId);
+    } else if (details.statusCode === 202) {
+      return handleBankRequest(wallet!, details.responseHeaders || [],
+        details.url,
+        details.tabId);
+    }
+  }, { urls: ["<all_urls>"] }, ["responseHeaders", "blocking"]);
+}
+
+
+/**
+ * Return a promise that resolves
+ * to the taler wallet db.
+ */
+function openTalerDb(): Promise<IDBDatabase> {
+  return new Promise<IDBDatabase>((resolve, reject) => {
+    const req = indexedDB.open(DB_NAME, DB_VERSION);
+    req.onerror = (e) => {
+      reject(e);
+    };
+    req.onsuccess = (e) => {
+      resolve(req.result);
+    };
+    req.onupgradeneeded = (e) => {
+      const db = req.result;
+      console.log("DB: upgrade needed: oldVersion = " + e.oldVersion);
+      switch (e.oldVersion) {
+        case 0: // DB does not exist yet
+
+          for (const n in Stores) {
+            if ((Stores as any)[n] instanceof Store) {
+              const si: Store<any> = (Stores as any)[n];
+              const s = db.createObjectStore(si.name, si.storeParams);
+              for (const indexName in (si as any)) {
+                if ((si as any)[indexName] instanceof Index) {
+                  const ii: Index<any, any> = (si as any)[indexName];
+                  s.createIndex(ii.indexName, ii.keyPath);
+                }
+              }
+            }
+          }
+          break;
+        default:
+          if (e.oldVersion !== DB_VERSION) {
+            window.alert("Incompatible wallet dababase version, please reset" +
+                         " db.");
+            chrome.browserAction.setBadgeText({text: "err"});
+            chrome.browserAction.setBadgeBackgroundColor({color: "#F00"});
+            throw Error("incompatible DB");
+          }
+          break;
+      }
+    };
+  });
+}
+
+
+function exportDb(db: IDBDatabase): Promise<any> {
+  const dump = {
+    name: db.name,
+    stores: {} as {[s: string]: any},
+    version: db.version,
+  };
+
+  return new Promise((resolve, reject) => {
+
+    const tx = db.transaction(Array.from(db.objectStoreNames));
+    tx.addEventListener("complete", () => {
+      resolve(dump);
+    });
+    // tslint:disable-next-line:prefer-for-of
+    for (let i = 0; i < db.objectStoreNames.length; i++) {
+      const name = db.objectStoreNames[i];
+      const storeDump = {} as {[s: string]: any};
+      dump.stores[name] = storeDump;
+      tx.objectStore(name)
+        .openCursor()
+        .addEventListener("success", (e: Event) => {
+          const cursor = (e.target as any).result;
+          if (cursor) {
+            storeDump[cursor.key] = cursor.value;
+            cursor.continue();
+          }
+        });
+    }
+  });
+}
+
+
+function importDb(db: IDBDatabase, dump: any): Promise<void> {
+  console.log("importing db", dump);
+  return new Promise<void>((resolve, reject) => {
+    const tx = db.transaction(Array.from(db.objectStoreNames), "readwrite");
+    if (dump.stores) {
+      for (const storeName in dump.stores) {
+        const objects = [];
+        const dumpStore = dump.stores[storeName];
+        for (const key in dumpStore) {
+          objects.push(dumpStore[key]);
+        }
+        console.log(`importing ${objects.length} records into ${storeName}`);
+        const store = tx.objectStore(storeName);
+        const clearReq = store.clear();
+        for (const obj of objects) {
+          store.put(obj);
+        }
+      }
+    }
+    tx.addEventListener("complete", () => {
+      resolve();
+    });
+  });
+}
+
+
+function deleteDb() {
+  indexedDB.deleteDatabase(DB_NAME);
+}
author	Florian Dold <florian.dold@gmail.com>	2017-05-28 23:15:41 +0200
committer	Florian Dold <florian.dold@gmail.com>	2017-05-28 23:15:41 +0200
commit	b6e774585d32017e5f1ceeeb2b2e2a5e350354d3 (patch)
tree	080cb5afe3b48c0428abd2d7de1ff7fe34d9b9b1 /src/webex
parent	38a74188d759444d7e1abac856f78ae710e2a4c5 (diff)